US10336775, Example 72
Modify Date: 2025-09-10 11:50:05
US10336775, Example 72 structure
|
Common Name | US10336775, Example 72 | ||
|---|---|---|---|---|
| CAS Number | 1884154-05-5 | Molecular Weight | 369.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H23N5O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | US10336775, Example 72 |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C19H23N5O3 |
|---|---|
| Molecular Weight | 369.4 |
| InChIKey | YHVKAILQOWJTDF-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1cnc(N2CCN(C(C)c3ccc4c(c3)OCO4)CC2)nc1 |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Human O-GlcNAcase enzyme inhibition assay from US Patent US10336775: "Glycosidase inh...
Source: BindingDB
Target: N/A
External Id: BindingDB_8611_1
|
Total 1, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of US10336775, Example 72? |
| A: Molecular formula of US10336775, Example 72 is C19H23N5O3. |
| Q: What is the InChIKey of US10336775, Example 72? |
| A: InChIKey of US10336775, Example 72 is YHVKAILQOWJTDF-UHFFFAOYSA-N. |
| Q: What is the molecular weight of US10336775, Example 72? |
| A: Molecular weight of US10336775, Example 72 is 369.4. |
| Q: What is the English name of US10336775, Example 72? |
| A: The English name of US10336775, Example 72 is US10336775, Example 72. |
| Q: What is the CAS number of US10336775, Example 72? |
| A: CAS number of US10336775, Example 72 is 1884154-05-5. |
| Q: What is the SMILES notation of US10336775, Example 72? |
| A: SMILES notation of US10336775, Example 72 is CC(=O)Nc1cnc(N2CCN(C(C)c3ccc4c(c3)OCO4)CC2)nc1. |
| Q: What is the Chinese name of 1884154-05-5? |
| A: Chinese name of 1884154-05-5 is 1884154-05-5. |