3-[5-(3,4-DICHLORO-PHENYL)-FURAN-2-YL]-ACRYLIC ACID structure
|
Common Name | 3-[5-(3,4-DICHLORO-PHENYL)-FURAN-2-YL]-ACRYLIC ACID | ||
|---|---|---|---|---|
| CAS Number | 188438-05-3 | Molecular Weight | 283.10700 | |
| Density | 1.436g/cm3 | Boiling Point | 446.7ºC at 760 mmHg | |
| Molecular Formula | C13H8Cl2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 224ºC | |
| Name | 3-[5-(3,4-dichlorophenyl)furan-2-yl]prop-2-enoic acid |
|---|
| Density | 1.436g/cm3 |
|---|---|
| Boiling Point | 446.7ºC at 760 mmHg |
| Molecular Formula | C13H8Cl2O3 |
| Molecular Weight | 283.10700 |
| Flash Point | 224ºC |
| Exact Mass | 281.98500 |
| PSA | 50.44000 |
| LogP | 4.35120 |
| Vapour Pressure | 9.18E-09mmHg at 25°C |
| Index of Refraction | 1.633 |
| InChIKey | RMUDYPIRNCPJPG-ZZXKWVIFSA-N |
| SMILES | O=C(O)C=Cc1ccc(-c2ccc(Cl)c(Cl)c2)o1 |
| HS Code | 2932190090 |
|---|
| HS Code | 2932190090 |
|---|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |