[R-(E)]-3-(1-Oxo-2-pentenyl)-4-phenyl-2-oxazolidinone structure
|
Common Name | [R-(E)]-3-(1-Oxo-2-pentenyl)-4-phenyl-2-oxazolidinone | ||
|---|---|---|---|---|
| CAS Number | 188559-05-9 | Molecular Weight | 245.27400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H15NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [R-(E)]-3-(1-Oxo-2-pentenyl)-4-phenyl-2-oxazolidinone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H15NO3 |
|---|---|
| Molecular Weight | 245.27400 |
| Exact Mass | 245.10500 |
| PSA | 46.61000 |
| LogP | 2.61060 |
| InChIKey | IIIXNQYVSNHXHJ-KBNZMGLGSA-N |
| SMILES | CCC=CC(=O)N1C(=O)OCC1c1ccccc1 |
|
~94%
[R-(E)]-3-(1-Ox... CAS#:188559-05-9 |
| Literature: Judge; Phillips; Morris; Lovasz; Romines; Luke; Tulinsky; Tustin; Chrusciel; Dolak; Mizsak; Watt; Vander Velde; Strohbach; Gammill Journal of the American Chemical Society, 1997 , vol. 119, # 15 p. 3627 - 3628 |
| (4R)-3-[(2E)-1-Oxo-2-penten-1-yl]-4-phenyl-2-oxazolidinone |
| (R)-N-[(E)-EtCHCHC(O)]-4-phenyl-1,3-oxazolidin-2-one |
| (4R)-3-[(2E)-1-Oxo-2-pentenyl]-4-phenyl-2-oxazolidinone |