N-[(4-nitrophenyl)methyl]-2-phenoxy-acetamide structure
|
Common Name | N-[(4-nitrophenyl)methyl]-2-phenoxy-acetamide | ||
|---|---|---|---|---|
| CAS Number | 18861-30-8 | Molecular Weight | 286.28300 | |
| Density | 1.272g/cm3 | Boiling Point | 555.3ºC at 760 mmHg | |
| Molecular Formula | C15H14N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 289.6ºC | |
| Name | N-[(4-nitrophenyl)methyl]-2-phenoxyacetamide |
|---|
| Density | 1.272g/cm3 |
|---|---|
| Boiling Point | 555.3ºC at 760 mmHg |
| Molecular Formula | C15H14N2O4 |
| Molecular Weight | 286.28300 |
| Flash Point | 289.6ºC |
| Exact Mass | 286.09500 |
| PSA | 84.15000 |
| LogP | 3.20410 |
| Vapour Pressure | 2.28E-12mmHg at 25°C |
| Index of Refraction | 1.599 |
| InChIKey | DEMSRZKAFGFECZ-UHFFFAOYSA-N |
| SMILES | O=C(COc1ccccc1)NCc1ccc([N+](=O)[O-])cc1 |
|
~%
N-[(4-nitrophen... CAS#:18861-30-8 |
| Literature: Baker,B.R.; Hurlbut,J.A. Journal of Medicinal Chemistry, 1967 , vol. 10, p. 1129 - 1133 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |