Tetrakis[2-(diethylamino)ethoxy]silane structure
|
Common Name | Tetrakis[2-(diethylamino)ethoxy]silane | ||
|---|---|---|---|---|
| CAS Number | 18867-06-6 | Molecular Weight | 492.81100 | |
| Density | 0.957g/cm3 | Boiling Point | 474.8ºC at 760 mmHg | |
| Molecular Formula | C24H56N4O4Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 240.9ºC | |
| Name | tetrakis[2-(diethylamino)ethyl] silicate |
|---|
| Density | 0.957g/cm3 |
|---|---|
| Boiling Point | 474.8ºC at 760 mmHg |
| Molecular Formula | C24H56N4O4Si |
| Molecular Weight | 492.81100 |
| Flash Point | 240.9ºC |
| Exact Mass | 492.40700 |
| PSA | 49.88000 |
| LogP | 2.85560 |
| Vapour Pressure | 3.51E-09mmHg at 25°C |
| Index of Refraction | 1.47 |
| InChIKey | NQESJUSXUOPEDI-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCO[Si](OCCN(CC)CC)(OCCN(CC)CC)OCCN(CC)CC |
| HS Code | 2922499990 |
|---|
|
~%
Tetrakis[2-(die... CAS#:18867-06-6 |
| Literature: CIBA SPECIALTY CHEMICALS HOLDING INC.; CIBA SPECIALITY CHEMICALS S.P.A. Patent: WO2003/101947 A2, 2003 ; Location in patent: Page 39 ; |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |