(1R,2R)-(-)-2-BENZYLOXYCYCLOHEXYLAMINE structure
|
Common Name | (1R,2R)-(-)-2-BENZYLOXYCYCLOHEXYLAMINE | ||
|---|---|---|---|---|
| CAS Number | 18867-45-3 | Molecular Weight | 240.25600 | |
| Density | 1.284g/cm3 | Boiling Point | 418.6ºC at 760mmHg | |
| Molecular Formula | C11H16N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 207ºC | |
| Name | (1R,2R)-2-(N,N-Dimethylamino)-1-(p-nitrophenyl)-1,3-propanediol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.284g/cm3 |
|---|---|
| Boiling Point | 418.6ºC at 760mmHg |
| Molecular Formula | C11H16N2O4 |
| Molecular Weight | 240.25600 |
| Flash Point | 207ºC |
| Exact Mass | 240.11100 |
| PSA | 89.52000 |
| LogP | 1.07390 |
| Vapour Pressure | 9.35E-08mmHg at 25°C |
| Index of Refraction | 1.588 |
| InChIKey | WKFXOUSFZMOKOH-GHMZBOCLSA-N |
| SMILES | CN(C)C(CO)C(O)c1ccc([N+](=O)[O-])cc1 |
| HS Code | 2922199090 |
|---|
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-hydroxycyclohexyl benzoate |