2,4-Diamino-4-(3,4-dimethoxyphenyl)butanoic acid
Modify Date: 2025-09-09 15:54:56
2,4-Diamino-4-(3,4-dimethoxyphenyl)butanoic acid structure
|
Common Name | 2,4-Diamino-4-(3,4-dimethoxyphenyl)butanoic acid | ||
|---|---|---|---|---|
| CAS Number | 1888686-64-3 | Molecular Weight | 254.28 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H18N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,4-Diamino-4-(3,4-dimethoxyphenyl)butanoic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H18N2O4 |
|---|---|
| Molecular Weight | 254.28 |
| InChIKey | ASFXACKXHVTOFU-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(N)CC(N)C(=O)O)cc1OC |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 2,4-Diamino-4-(3,4-dimethoxyphenyl)butanoic acid? |
| A: InChIKey of 2,4-Diamino-4-(3,4-dimethoxyphenyl)butanoic acid is ASFXACKXHVTOFU-UHFFFAOYSA-N. |
| Q: What is the English name of 2,4-Diamino-4-(3,4-dimethoxyphenyl)butanoic acid? |
| A: The English name of 2,4-Diamino-4-(3,4-dimethoxyphenyl)butanoic acid is 2,4-Diamino-4-(3,4-dimethoxyphenyl)butanoic acid. |
| Q: What is the molecular formula of 2,4-Diamino-4-(3,4-dimethoxyphenyl)butanoic acid? |
| A: Molecular formula of 2,4-Diamino-4-(3,4-dimethoxyphenyl)butanoic acid is C12H18N2O4. |
| Q: What is the CAS number of 2,4-Diamino-4-(3,4-dimethoxyphenyl)butanoic acid? |
| A: CAS number of 2,4-Diamino-4-(3,4-dimethoxyphenyl)butanoic acid is 1888686-64-3. |
| Q: What is the molecular weight of 2,4-Diamino-4-(3,4-dimethoxyphenyl)butanoic acid? |
| A: Molecular weight of 2,4-Diamino-4-(3,4-dimethoxyphenyl)butanoic acid is 254.28. |
| Q: What is the Chinese name of 1888686-64-3? |
| A: Chinese name of 1888686-64-3 is 1888686-64-3. |
| Q: What is the SMILES notation of 2,4-Diamino-4-(3,4-dimethoxyphenyl)butanoic acid? |
| A: SMILES notation of 2,4-Diamino-4-(3,4-dimethoxyphenyl)butanoic acid is COc1ccc(C(N)CC(N)C(=O)O)cc1OC. |