1,3,5-Tris(dibromomethyl)benzene structure
|
Common Name | 1,3,5-Tris(dibromomethyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 1889-66-3 | Molecular Weight | 593.56800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H6Br6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,3,5-Tris(dibromomethyl)benzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H6Br6 |
|---|---|
| Molecular Weight | 593.56800 |
| Exact Mass | 587.55700 |
| LogP | 7.05180 |
| InChIKey | BXGZVNSQLBRQQO-UHFFFAOYSA-N |
| SMILES | BrC(Br)c1cc(C(Br)Br)cc(C(Br)Br)c1 |
| HS Code | 2903999090 |
|---|
|
~48%
1,3,5-Tris(dibr... CAS#:1889-66-3 |
| Literature: Shao, Jie; Qiao, Yanhong; Lin, Hai; Lin, Huakuan Spectrochimica Acta - Part A: Molecular and Biomolecular Spectroscopy, 2009 , vol. 71, # 5 p. 1736 - 1740 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2903999090 |
|---|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 1,3,5-Tris(dibrommethyl)benzol |
| Hexabrommesitylen |
| Benzene,1,3,5-tris(dibromomethyl) |
| 1,3,5-tris[bis(bromanyl)methyl]benzene |