(S)-(3-(3,4-DICHLOROPHENYL)-3-(3-IODOPROPYL)PIPERIDIN-1-YL)(PHENYL)METHANONE structure
|
Common Name | (S)-(3-(3,4-DICHLOROPHENYL)-3-(3-IODOPROPYL)PIPERIDIN-1-YL)(PHENYL)METHANONE | ||
|---|---|---|---|---|
| CAS Number | 188916-67-8 | Molecular Weight | 502.21600 | |
| Density | 1.503 | Boiling Point | N/A | |
| Molecular Formula | C21H22Cl2INO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [(3S)-3-(3,4-dichlorophenyl)-3-(3-iodopropyl)piperidin-1-yl]-phenylmethanone |
|---|
| Density | 1.503 |
|---|---|
| Molecular Formula | C21H22Cl2INO |
| Molecular Weight | 502.21600 |
| Exact Mass | 501.01200 |
| PSA | 20.31000 |
| LogP | 6.32050 |
| InChIKey | XFAAEZSRGNMTTA-NRFANRHFSA-N |
| SMILES | O=C(c1ccccc1)N1CCCC(CCCI)(c2ccc(Cl)c(Cl)c2)C1 |
| HS Code | 2933399090 |
|---|
|
~98%
(S)-(3-(3,4-DIC... CAS#:188916-67-8 |
| Literature: Chen, Huai G.; Chung; Goel; Johnson; Kesten; Knobelsdorf; Lee; Rubin Bioorganic and Medicinal Chemistry Letters, 1997 , vol. 7, # 5 p. 555 - 560 |
|
~%
(S)-(3-(3,4-DIC... CAS#:188916-67-8 |
| Literature: Chen, Huai G.; Chung; Goel; Johnson; Kesten; Knobelsdorf; Lee; Rubin Bioorganic and Medicinal Chemistry Letters, 1997 , vol. 7, # 5 p. 555 - 560 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |