2-Methyl-3-[2-(propan-2-yl)-1,3-thiazol-4-yl]propanoic acid
Modify Date: 2026-07-24 09:03:20
![2-Methyl-3-[2-(propan-2-yl)-1,3-thiazol-4-yl]propanoic acid Structure](https://www.chemsrc.com/extcaspic/164/1889519-82-7.png)
2-Methyl-3-[2-(propan-2-yl)-1,3-thiazol-4-yl]propanoic acid structure
|
Common Name | 2-Methyl-3-[2-(propan-2-yl)-1,3-thiazol-4-yl]propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 1889519-82-7 | Molecular Weight | 213.30 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H15NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-Methyl-3-[2-(propan-2-yl)-1,3-thiazol-4-yl]propanoic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H15NO2S |
|---|---|
| Molecular Weight | 213.30 |
| InChIKey | GHNLODVFLSOQHX-UHFFFAOYSA-N |
| SMILES | CC(Cc1csc(C(C)C)n1)C(=O)O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 2-Methyl-3-[2-(propan-2-yl)-1,3-thiazol-4-yl]propanoic acid? |
| A: InChIKey of 2-Methyl-3-[2-(propan-2-yl)-1,3-thiazol-4-yl]propanoic acid is GHNLODVFLSOQHX-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 2-Methyl-3-[2-(propan-2-yl)-1,3-thiazol-4-yl]propanoic acid? |
| A: SMILES notation of 2-Methyl-3-[2-(propan-2-yl)-1,3-thiazol-4-yl]propanoic acid is CC(Cc1csc(C(C)C)n1)C(=O)O. |
| Q: What is the CAS number of 2-Methyl-3-[2-(propan-2-yl)-1,3-thiazol-4-yl]propanoic acid? |
| A: CAS number of 2-Methyl-3-[2-(propan-2-yl)-1,3-thiazol-4-yl]propanoic acid is 1889519-82-7. |
| Q: What is the English name of 2-Methyl-3-[2-(propan-2-yl)-1,3-thiazol-4-yl]propanoic acid? |
| A: The English name of 2-Methyl-3-[2-(propan-2-yl)-1,3-thiazol-4-yl]propanoic acid is 2-Methyl-3-[2-(propan-2-yl)-1,3-thiazol-4-yl]propanoic acid. |
| Q: What is the Chinese name of 1889519-82-7? |
| A: Chinese name of 1889519-82-7 is 1889519-82-7. |
| Q: What is the molecular weight of 2-Methyl-3-[2-(propan-2-yl)-1,3-thiazol-4-yl]propanoic acid? |
| A: Molecular weight of 2-Methyl-3-[2-(propan-2-yl)-1,3-thiazol-4-yl]propanoic acid is 213.30. |
| Q: What is the molecular formula of 2-Methyl-3-[2-(propan-2-yl)-1,3-thiazol-4-yl]propanoic acid? |
| A: Molecular formula of 2-Methyl-3-[2-(propan-2-yl)-1,3-thiazol-4-yl]propanoic acid is C10H15NO2S. |