5-fluoro AMB metabolite 3 structure
|
Common Name | 5-fluoro AMB metabolite 3 | ||
|---|---|---|---|---|
| CAS Number | 1890250-21-1 | Molecular Weight | 375.419 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 626.0±45.0 °C at 760 mmHg | |
| Molecular Formula | C19H25N3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 332.4±28.7 °C | |
Use of 5-fluoro AMB metabolite 35-fluoro AMB metabolite 3 is an analytical reference standard that is structurally similar to known synthetic cannabinoids. |
| Name | 5-(3-{[(2S)-1-Methoxy-3-methyl-1-oxo-2-butanyl]carbamoyl}-1H-indazol-1-yl)pentanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 626.0±45.0 °C at 760 mmHg |
| Molecular Formula | C19H25N3O5 |
| Molecular Weight | 375.419 |
| Flash Point | 332.4±28.7 °C |
| Exact Mass | 375.179413 |
| LogP | 1.83 |
| Vapour Pressure | 0.0±1.9 mmHg at 25°C |
| Index of Refraction | 1.589 |
| InChIKey | PHUYBCJFBMJODK-INIZCTEOSA-N |
| SMILES | COC(=O)C(NC(=O)c1nn(CCCCC(=O)O)c2ccccc12)C(C)C |
| 5-(3-{[(2S)-1-Methoxy-3-methyl-1-oxo-2-butanyl]carbamoyl}-1H-indazol-1-yl)pentanoic acid |
| L-Valine, N-[[1-(4-carboxybutyl)-1H-indazol-3-yl]carbonyl]-, methyl ester |