Methanone,(4-chlorophenyl)(4-phenyl-1-piperazinyl)- structure
|
Common Name | Methanone,(4-chlorophenyl)(4-phenyl-1-piperazinyl)- | ||
|---|---|---|---|---|
| CAS Number | 18907-57-8 | Molecular Weight | 300.78300 | |
| Density | 1.244g/cm3 | Boiling Point | 479.5ºC at 760mmHg | |
| Molecular Formula | C17H17ClN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 243.8ºC | |
| Name | 1-(p-Chlorobenzoyl)-3-(1H-tetrazol-5-ylmethyl)indole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.244g/cm3 |
|---|---|
| Boiling Point | 479.5ºC at 760mmHg |
| Molecular Formula | C17H17ClN2O |
| Molecular Weight | 300.78300 |
| Flash Point | 243.8ºC |
| Exact Mass | 300.10300 |
| PSA | 23.55000 |
| LogP | 3.30530 |
| Vapour Pressure | 2.34E-09mmHg at 25°C |
| Index of Refraction | 1.616 |
| InChIKey | MMRSPHBFKOUXJI-UHFFFAOYSA-N |
| SMILES | O=C(c1ccc(Cl)cc1)N1CCN(c2ccccc2)CC1 |
|
~%
Methanone,(4-ch... CAS#:18907-57-8 |
| Literature: Pollard; Gray Journal of the American Chemical Society, 1953 , vol. 75, p. 491 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Intrazol [INN-Spanish] |
| 1-(p-Chlor-benzoyl)-4-phenyl-piperazin |
| Intrazole |
| 1-(4-Chlorobenzoyl)-3-(5-tetrazolylmethyl)indole |
| 1-(4-Chlor-benzoyl)-4-phenyl-piperazin |
| 1-(4-chloro-benzoyl)-3-(1(2)H-tetrazol-5-ylmethyl)-indole |
| 1-(4-chloro-benzoyl)-4-phenyl-piperazine |
| 1H-Indole,1-(4-chlorobenzoyl)-3-(1H-tetrazol-5-ylmethyl) |
| Intrazolum [INN-Latin] |
| 1-(4-Chlor-benzoyl)-3-(tetrazolyl-(5)-methyl)-indol |
| INDOLE,1-(p-CHLOROBENZOYL)-3-(1H-TETRAZOL-5-YLMETHYL) |
| Intrazolo [DCIT] |
| BL-R 743 |