4-azido-1-(4-methoxyphenyl)butan-1-one structure
|
Common Name | 4-azido-1-(4-methoxyphenyl)butan-1-one | ||
|---|---|---|---|---|
| CAS Number | 189079-75-2 | Molecular Weight | 219.24000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H13N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-azido-1-(4-methoxyphenyl)butan-1-one |
|---|
| Molecular Formula | C11H13N3O2 |
|---|---|
| Molecular Weight | 219.24000 |
| Exact Mass | 219.10100 |
| PSA | 76.05000 |
| LogP | 2.42116 |
| InChIKey | RORQLBFGNHMBBF-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)CCCN=[N+]=[N-])cc1 |
|
~92%
4-azido-1-(4-me... CAS#:189079-75-2 |
| Literature: Weinstein, David S.; Ngu, Khehyong; Robl, Jeffrey A. Patent: US2005/70588 A1, 2005 ; Location in patent: Page/Page column 14 ; US 20050070588 A1 |
|
~%
4-azido-1-(4-me... CAS#:189079-75-2 |
| Literature: Chowdhury, Nilanjana; Dutta, Sansa; Karthick; Anoop, Anakuthil; Dasgupta, Swagata; Pradeep Singh Journal of Photochemistry and Photobiology B: Biology, 2012 , vol. 115, p. 25 - 34 |