4-azido-1-(4-methoxyphenyl)butan-1-one
4-azido-1-(4-methoxyphenyl)butan-1-one structure
|
Common Name | 4-azido-1-(4-methoxyphenyl)butan-1-one | ||
|---|---|---|---|---|
| CAS Number | 189079-75-2 | Molecular Weight | 219.24000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H13N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 4-Azido-1-(4-methoxyphenyl)butan-1-one (CAS number: 189079-75-2, molecular formula: C11H13N3O2, molecular weight: 219.24) For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-azido-1-(4-methoxyphenyl)butan-1-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H13N3O2 |
|---|---|
| Molecular Weight | 219.24000 |
| Exact Mass | 219.10100 |
| PSA | 76.05000 |
| LogP | 2.42116 |
| InChIKey | RORQLBFGNHMBBF-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)CCCN=[N+]=[N-])cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~92%
4-azido-1-(4-me... CAS#:189079-75-2 |
| Literature: Weinstein, David S.; Ngu, Khehyong; Robl, Jeffrey A. Patent: US2005/70588 A1, 2005 ; Location in patent: Page/Page column 14 ; US 20050070588 A1 |
|
~%
4-azido-1-(4-me... CAS#:189079-75-2 |
| Literature: Chowdhury, Nilanjana; Dutta, Sansa; Karthick; Anoop, Anakuthil; Dasgupta, Swagata; Pradeep Singh Journal of Photochemistry and Photobiology B: Biology, 2012 , vol. 115, p. 25 - 34 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 4-azido-1-(4-methoxyphenyl)butan-1-one? |
| A: SMILES notation of 4-azido-1-(4-methoxyphenyl)butan-1-one is COc1ccc(C(=O)CCCN=[N+]=[N-])cc1. |
| Q: What is the polar surface area (PSA) of 4-azido-1-(4-methoxyphenyl)butan-1-one? |
| A: Polar surface area (PSA) of 4-azido-1-(4-methoxyphenyl)butan-1-one is 76.05000. |
| Q: What is the LogP of 4-azido-1-(4-methoxyphenyl)butan-1-one? |
| A: LogP of 4-azido-1-(4-methoxyphenyl)butan-1-one is 2.42116. |
| Q: What is the Chinese name of 189079-75-2? |
| A: Chinese name of 189079-75-2 is 189079-75-2. |
| Q: What is the molecular formula of 4-azido-1-(4-methoxyphenyl)butan-1-one? |
| A: Molecular formula of 4-azido-1-(4-methoxyphenyl)butan-1-one is C11H13N3O2. |
| Q: What is the CAS number of 4-azido-1-(4-methoxyphenyl)butan-1-one? |
| A: CAS number of 4-azido-1-(4-methoxyphenyl)butan-1-one is 189079-75-2. |
| Q: What is the molecular weight of 4-azido-1-(4-methoxyphenyl)butan-1-one? |
| A: Molecular weight of 4-azido-1-(4-methoxyphenyl)butan-1-one is 219.24000. |
| Q: What is the InChIKey of 4-azido-1-(4-methoxyphenyl)butan-1-one? |
| A: InChIKey of 4-azido-1-(4-methoxyphenyl)butan-1-one is RORQLBFGNHMBBF-UHFFFAOYSA-N. |
| Q: What is the English name of 4-azido-1-(4-methoxyphenyl)butan-1-one? |
| A: The English name of 4-azido-1-(4-methoxyphenyl)butan-1-one is 4-azido-1-(4-methoxyphenyl)butan-1-one. |