1,4-Dinitro-2,5-dibromobenzene
1,4-Dinitro-2,5-dibromobenzene structure
|
Common Name | 1,4-Dinitro-2,5-dibromobenzene | ||
|---|---|---|---|---|
| CAS Number | 18908-08-2 | Molecular Weight | 325.89900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H2Br2N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,4-dibromo-2,5-bisnitrobenzene |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C6H2Br2N2O4 |
|---|---|
| Molecular Weight | 325.89900 |
| Exact Mass | 323.83800 |
| PSA | 91.64000 |
| LogP | 4.07440 |
| InChIKey | QHTZEKUEAHGFIS-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc(Br)c([N+](=O)[O-])cc1Br |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2904909090 |
|---|
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1,4-dibromo-2,5-dinitrobenzene |
| 1,4-Dibrom-2,5-dinitro-benzol |
| 1,4-dibromo-2,5-dinitro-benzene |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of 1,4-dibromo-2,5-bisnitrobenzene? |
| A: LogP of 1,4-dibromo-2,5-bisnitrobenzene is 4.07440. |
| Q: What is the molecular weight of 1,4-dibromo-2,5-bisnitrobenzene? |
| A: Molecular weight of 1,4-dibromo-2,5-bisnitrobenzene is 325.89900. |
| Q: What is the Chinese name of 18908-08-2? |
| A: Chinese name of 18908-08-2 is 18908-08-2. |
| Q: What is the molecular formula of 1,4-dibromo-2,5-bisnitrobenzene? |
| A: Molecular formula of 1,4-dibromo-2,5-bisnitrobenzene is C6H2Br2N2O4. |
| Q: What is the English name of 1,4-dibromo-2,5-bisnitrobenzene? |
| A: The English name of 1,4-dibromo-2,5-bisnitrobenzene is 1,4-dibromo-2,5-bisnitrobenzene. |
| Q: What is the SMILES notation of 1,4-dibromo-2,5-bisnitrobenzene? |
| A: SMILES notation of 1,4-dibromo-2,5-bisnitrobenzene is O=[N+]([O-])c1cc(Br)c([N+](=O)[O-])cc1Br. |
| Q: What English synonyms does 1,4-dibromo-2,5-bisnitrobenzene have? |
| A: English synonyms of 1,4-dibromo-2,5-bisnitrobenzene: 1,4-dibromo-2,5-dinitrobenzene, 1,4-Dibrom-2,5-dinitro-benzol, 1,4-dibromo-2,5-dinitro-benzene. |
| Q: What is the polar surface area (PSA) of 1,4-dibromo-2,5-bisnitrobenzene? |
| A: Polar surface area (PSA) of 1,4-dibromo-2,5-bisnitrobenzene is 91.64000. |
| Q: What is the CAS number of 1,4-dibromo-2,5-bisnitrobenzene? |
| A: CAS number of 1,4-dibromo-2,5-bisnitrobenzene is 18908-08-2. |
| Q: What is the InChIKey of 1,4-dibromo-2,5-bisnitrobenzene? |
| A: InChIKey of 1,4-dibromo-2,5-bisnitrobenzene is QHTZEKUEAHGFIS-UHFFFAOYSA-N. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |