3-(1-Aminocyclopentyl)aniline hydrochloride
Modify Date: 2025-09-10 10:49:18
3-(1-Aminocyclopentyl)aniline hydrochloride structure
|
Common Name | 3-(1-Aminocyclopentyl)aniline hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 1890835-00-3 | Molecular Weight | 212.72 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H17ClN2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-(1-Aminocyclopentyl)aniline hydrochloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H17ClN2 |
|---|---|
| Molecular Weight | 212.72 |
| InChIKey | VDYOBFGBOIIYLB-UHFFFAOYSA-N |
| SMILES | Cl.Nc1cccc(C2(N)CCCC2)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 3-(1-Aminocyclopentyl)aniline hydrochloride? |
| A: SMILES notation of 3-(1-Aminocyclopentyl)aniline hydrochloride is Cl.Nc1cccc(C2(N)CCCC2)c1. |
| Q: What is the molecular weight of 3-(1-Aminocyclopentyl)aniline hydrochloride? |
| A: Molecular weight of 3-(1-Aminocyclopentyl)aniline hydrochloride is 212.72. |
| Q: What is the Chinese name of 1890835-00-3? |
| A: Chinese name of 1890835-00-3 is 1890835-00-3. |
| Q: What is the molecular formula of 3-(1-Aminocyclopentyl)aniline hydrochloride? |
| A: Molecular formula of 3-(1-Aminocyclopentyl)aniline hydrochloride is C11H17ClN2. |
| Q: What is the InChIKey of 3-(1-Aminocyclopentyl)aniline hydrochloride? |
| A: InChIKey of 3-(1-Aminocyclopentyl)aniline hydrochloride is VDYOBFGBOIIYLB-UHFFFAOYSA-N. |
| Q: What is the CAS number of 3-(1-Aminocyclopentyl)aniline hydrochloride? |
| A: CAS number of 3-(1-Aminocyclopentyl)aniline hydrochloride is 1890835-00-3. |
| Q: What is the English name of 3-(1-Aminocyclopentyl)aniline hydrochloride? |
| A: The English name of 3-(1-Aminocyclopentyl)aniline hydrochloride is 3-(1-Aminocyclopentyl)aniline hydrochloride. |