1-methyl-4-phenyl-piperidine-3,4-diol
1-methyl-4-phenyl-piperidine-3,4-diol structure
|
Common Name | 1-methyl-4-phenyl-piperidine-3,4-diol | ||
|---|---|---|---|---|
| CAS Number | 1891-20-9 | Molecular Weight | 207.26900 | |
| Density | 1.19g/cm3 | Boiling Point | 352.6ºC at 760 mmHg | |
| Molecular Formula | C12H17NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 182ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-methyl-4-phenylpiperidine-3,4-diol |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.19g/cm3 |
|---|---|
| Boiling Point | 352.6ºC at 760 mmHg |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.26900 |
| Flash Point | 182ºC |
| Exact Mass | 207.12600 |
| PSA | 43.70000 |
| LogP | 0.50850 |
| Vapour Pressure | 1.4E-05mmHg at 25°C |
| Index of Refraction | 1.591 |
| InChIKey | HAATVDDNXGDFHD-UHFFFAOYSA-N |
| SMILES | CN1CCC(O)(c2ccccc2)C(O)C1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
1-methyl-4-phen... CAS#:1891-20-9 |
| Literature: McElvain; Safranski Journal of the American Chemical Society, 1950 , vol. 72, p. 3134,3135 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1-Methyl-4-phenyl-piperidin-3,4-diol |
| 1-Methyl-3,4-dihydroxy-4-phenyl-piperidin |
| 1-methyl-4-phenyl-piperidine-3,4-diol |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 1-methyl-4-phenylpiperidine-3,4-diol? |
| A: Molecular formula of 1-methyl-4-phenylpiperidine-3,4-diol is C12H17NO2. |
| Q: What is the boiling point of 1-methyl-4-phenylpiperidine-3,4-diol? |
| A: Boiling point of 1-methyl-4-phenylpiperidine-3,4-diol is 352.6ºC at 760 mmHg. |
| Q: What is the molecular weight of 1-methyl-4-phenylpiperidine-3,4-diol? |
| A: Molecular weight of 1-methyl-4-phenylpiperidine-3,4-diol is 207.26900. |
| Q: What is the polar surface area (PSA) of 1-methyl-4-phenylpiperidine-3,4-diol? |
| A: Polar surface area (PSA) of 1-methyl-4-phenylpiperidine-3,4-diol is 43.70000. |
| Q: What is the Chinese name of 1891-20-9? |
| A: Chinese name of 1891-20-9 is 1891-20-9. |
| Q: What English synonyms does 1-methyl-4-phenylpiperidine-3,4-diol have? |
| A: English synonyms of 1-methyl-4-phenylpiperidine-3,4-diol: 1-Methyl-4-phenyl-piperidin-3,4-diol, 1-Methyl-3,4-dihydroxy-4-phenyl-piperidin, 1-methyl-4-phenyl-piperidine-3,4-diol. |
| Q: What is the SMILES notation of 1-methyl-4-phenylpiperidine-3,4-diol? |
| A: SMILES notation of 1-methyl-4-phenylpiperidine-3,4-diol is CN1CCC(O)(c2ccccc2)C(O)C1. |
| Q: What is the English name of 1-methyl-4-phenylpiperidine-3,4-diol? |
| A: The English name of 1-methyl-4-phenylpiperidine-3,4-diol is 1-methyl-4-phenylpiperidine-3,4-diol. |
| Q: What is the LogP of 1-methyl-4-phenylpiperidine-3,4-diol? |
| A: LogP of 1-methyl-4-phenylpiperidine-3,4-diol is 0.50850. |
| Q: What is the CAS number of 1-methyl-4-phenylpiperidine-3,4-diol? |
| A: CAS number of 1-methyl-4-phenylpiperidine-3,4-diol is 1891-20-9. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |