1-methyl-4-phenyl-piperidine-3,4-diol structure
|
Common Name | 1-methyl-4-phenyl-piperidine-3,4-diol | ||
|---|---|---|---|---|
| CAS Number | 1891-20-9 | Molecular Weight | 207.26900 | |
| Density | 1.19g/cm3 | Boiling Point | 352.6ºC at 760 mmHg | |
| Molecular Formula | C12H17NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 182ºC | |
| Name | 1-methyl-4-phenylpiperidine-3,4-diol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.19g/cm3 |
|---|---|
| Boiling Point | 352.6ºC at 760 mmHg |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.26900 |
| Flash Point | 182ºC |
| Exact Mass | 207.12600 |
| PSA | 43.70000 |
| LogP | 0.50850 |
| Vapour Pressure | 1.4E-05mmHg at 25°C |
| Index of Refraction | 1.591 |
| InChIKey | HAATVDDNXGDFHD-UHFFFAOYSA-N |
| SMILES | CN1CCC(O)(c2ccccc2)C(O)C1 |
|
~%
1-methyl-4-phen... CAS#:1891-20-9 |
| Literature: McElvain; Safranski Journal of the American Chemical Society, 1950 , vol. 72, p. 3134,3135 |
| 1-Methyl-4-phenyl-piperidin-3,4-diol |
| 1-Methyl-3,4-dihydroxy-4-phenyl-piperidin |
| 1-methyl-4-phenyl-piperidine-3,4-diol |