{4-[4-Methyl-2-(propan-2-yl)-1,3-thiazol-5-yl]phenyl}methanamine
Modify Date: 2026-07-07 12:30:14
![{4-[4-Methyl-2-(propan-2-yl)-1,3-thiazol-5-yl]phenyl}methanamine Structure](https://www.chemsrc.com/extcaspic/117/1891415-92-1.png)
{4-[4-Methyl-2-(propan-2-yl)-1,3-thiazol-5-yl]phenyl}methanamine structure
|
Common Name | {4-[4-Methyl-2-(propan-2-yl)-1,3-thiazol-5-yl]phenyl}methanamine | ||
|---|---|---|---|---|
| CAS Number | 1891415-92-1 | Molecular Weight | 246.37 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H18N2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | {4-[4-Methyl-2-(propan-2-yl)-1,3-thiazol-5-yl]phenyl}methanamine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H18N2S |
|---|---|
| Molecular Weight | 246.37 |
| InChIKey | MDTWIKROSITRLO-UHFFFAOYSA-N |
| SMILES | Cc1nc(C(C)C)sc1-c1ccc(CN)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of {4-[4-Methyl-2-(propan-2-yl)-1,3-thiazol-5-yl]phenyl}methanamine? |
| A: SMILES notation of {4-[4-Methyl-2-(propan-2-yl)-1,3-thiazol-5-yl]phenyl}methanamine is Cc1nc(C(C)C)sc1-c1ccc(CN)cc1. |
| Q: What is the Chinese name of 1891415-92-1? |
| A: Chinese name of 1891415-92-1 is 1891415-92-1. |
| Q: What is the molecular formula of {4-[4-Methyl-2-(propan-2-yl)-1,3-thiazol-5-yl]phenyl}methanamine? |
| A: Molecular formula of {4-[4-Methyl-2-(propan-2-yl)-1,3-thiazol-5-yl]phenyl}methanamine is C14H18N2S. |
| Q: What is the CAS number of {4-[4-Methyl-2-(propan-2-yl)-1,3-thiazol-5-yl]phenyl}methanamine? |
| A: CAS number of {4-[4-Methyl-2-(propan-2-yl)-1,3-thiazol-5-yl]phenyl}methanamine is 1891415-92-1. |
| Q: What is the InChIKey of {4-[4-Methyl-2-(propan-2-yl)-1,3-thiazol-5-yl]phenyl}methanamine? |
| A: InChIKey of {4-[4-Methyl-2-(propan-2-yl)-1,3-thiazol-5-yl]phenyl}methanamine is MDTWIKROSITRLO-UHFFFAOYSA-N. |
| Q: What is the molecular weight of {4-[4-Methyl-2-(propan-2-yl)-1,3-thiazol-5-yl]phenyl}methanamine? |
| A: Molecular weight of {4-[4-Methyl-2-(propan-2-yl)-1,3-thiazol-5-yl]phenyl}methanamine is 246.37. |
| Q: What is the English name of {4-[4-Methyl-2-(propan-2-yl)-1,3-thiazol-5-yl]phenyl}methanamine? |
| A: The English name of {4-[4-Methyl-2-(propan-2-yl)-1,3-thiazol-5-yl]phenyl}methanamine is {4-[4-Methyl-2-(propan-2-yl)-1,3-thiazol-5-yl]phenyl}methanamine. |