2-[1-(1-Aminoethyl)cyclopropyl]-4,5-dimethylphenol
Modify Date: 2025-08-27 11:11:27
![2-[1-(1-Aminoethyl)cyclopropyl]-4,5-dimethylphenol Structure](https://www.chemsrc.com/extcaspic/151/1891428-29-7.png)
2-[1-(1-Aminoethyl)cyclopropyl]-4,5-dimethylphenol structure
|
Common Name | 2-[1-(1-Aminoethyl)cyclopropyl]-4,5-dimethylphenol | ||
|---|---|---|---|---|
| CAS Number | 1891428-29-7 | Molecular Weight | 205.30 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H19NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-[1-(1-Aminoethyl)cyclopropyl]-4,5-dimethylphenol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H19NO |
|---|---|
| Molecular Weight | 205.30 |
| InChIKey | YNECEIKCOZUVLS-UHFFFAOYSA-N |
| SMILES | Cc1cc(O)c(C2(C(C)N)CC2)cc1C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 2-[1-(1-Aminoethyl)cyclopropyl]-4,5-dimethylphenol? |
| A: CAS number of 2-[1-(1-Aminoethyl)cyclopropyl]-4,5-dimethylphenol is 1891428-29-7. |
| Q: What is the molecular weight of 2-[1-(1-Aminoethyl)cyclopropyl]-4,5-dimethylphenol? |
| A: Molecular weight of 2-[1-(1-Aminoethyl)cyclopropyl]-4,5-dimethylphenol is 205.30. |
| Q: What is the InChIKey of 2-[1-(1-Aminoethyl)cyclopropyl]-4,5-dimethylphenol? |
| A: InChIKey of 2-[1-(1-Aminoethyl)cyclopropyl]-4,5-dimethylphenol is YNECEIKCOZUVLS-UHFFFAOYSA-N. |
| Q: What is the English name of 2-[1-(1-Aminoethyl)cyclopropyl]-4,5-dimethylphenol? |
| A: The English name of 2-[1-(1-Aminoethyl)cyclopropyl]-4,5-dimethylphenol is 2-[1-(1-Aminoethyl)cyclopropyl]-4,5-dimethylphenol. |
| Q: What is the SMILES notation of 2-[1-(1-Aminoethyl)cyclopropyl]-4,5-dimethylphenol? |
| A: SMILES notation of 2-[1-(1-Aminoethyl)cyclopropyl]-4,5-dimethylphenol is Cc1cc(O)c(C2(C(C)N)CC2)cc1C. |
| Q: What is the Chinese name of 1891428-29-7? |
| A: Chinese name of 1891428-29-7 is 1891428-29-7. |
| Q: What is the molecular formula of 2-[1-(1-Aminoethyl)cyclopropyl]-4,5-dimethylphenol? |
| A: Molecular formula of 2-[1-(1-Aminoethyl)cyclopropyl]-4,5-dimethylphenol is C13H19NO. |