3-(6-Methoxy-1,3-dioxaindan-5-yl)-2,2-dimethylpropanoic acid
Modify Date: 2026-07-12 06:46:37
3-(6-Methoxy-1,3-dioxaindan-5-yl)-2,2-dimethylpropanoic acid structure
|
Common Name | 3-(6-Methoxy-1,3-dioxaindan-5-yl)-2,2-dimethylpropanoic acid | ||
|---|---|---|---|---|
| CAS Number | 1891862-78-4 | Molecular Weight | 252.26 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H16O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-(6-Methoxy-1,3-dioxaindan-5-yl)-2,2-dimethylpropanoic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H16O5 |
|---|---|
| Molecular Weight | 252.26 |
| InChIKey | SRRMONKEVSTCCC-UHFFFAOYSA-N |
| SMILES | COc1cc2c(cc1CC(C)(C)C(=O)O)OCO2 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 3-(6-Methoxy-1,3-dioxaindan-5-yl)-2,2-dimethylpropanoic acid? |
| A: The English name of 3-(6-Methoxy-1,3-dioxaindan-5-yl)-2,2-dimethylpropanoic acid is 3-(6-Methoxy-1,3-dioxaindan-5-yl)-2,2-dimethylpropanoic acid. |
| Q: What is the SMILES notation of 3-(6-Methoxy-1,3-dioxaindan-5-yl)-2,2-dimethylpropanoic acid? |
| A: SMILES notation of 3-(6-Methoxy-1,3-dioxaindan-5-yl)-2,2-dimethylpropanoic acid is COc1cc2c(cc1CC(C)(C)C(=O)O)OCO2. |
| Q: What is the molecular formula of 3-(6-Methoxy-1,3-dioxaindan-5-yl)-2,2-dimethylpropanoic acid? |
| A: Molecular formula of 3-(6-Methoxy-1,3-dioxaindan-5-yl)-2,2-dimethylpropanoic acid is C13H16O5. |
| Q: What is the InChIKey of 3-(6-Methoxy-1,3-dioxaindan-5-yl)-2,2-dimethylpropanoic acid? |
| A: InChIKey of 3-(6-Methoxy-1,3-dioxaindan-5-yl)-2,2-dimethylpropanoic acid is SRRMONKEVSTCCC-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 1891862-78-4? |
| A: Chinese name of 1891862-78-4 is 1891862-78-4. |
| Q: What is the CAS number of 3-(6-Methoxy-1,3-dioxaindan-5-yl)-2,2-dimethylpropanoic acid? |
| A: CAS number of 3-(6-Methoxy-1,3-dioxaindan-5-yl)-2,2-dimethylpropanoic acid is 1891862-78-4. |
| Q: What is the molecular weight of 3-(6-Methoxy-1,3-dioxaindan-5-yl)-2,2-dimethylpropanoic acid? |
| A: Molecular weight of 3-(6-Methoxy-1,3-dioxaindan-5-yl)-2,2-dimethylpropanoic acid is 252.26. |