Trimethylsilyldulcitol structure
|
Common Name | Trimethylsilyldulcitol | ||
|---|---|---|---|---|
| CAS Number | 18919-39-6 | Molecular Weight | 615.25800 | |
| Density | 1.531g/cm3 | Boiling Point | 272.1ºC at 760 mmHg | |
| Molecular Formula | C24H62O6Si6 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 118.3ºC | |
Use of TrimethylsilyldulcitolTrimethylsilyldulcitol is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
| Name | trimethyl-[(2S,3R,4S,5R)-1,2,4,5,6-pentakis(trimethylsilyloxy)hexan-3-yl]oxysilane |
|---|---|
| Synonym | More Synonyms |
| Description | Trimethylsilyldulcitol is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
|---|---|
| Related Catalog |
| Density | 1.531g/cm3 |
|---|---|
| Boiling Point | 272.1ºC at 760 mmHg |
| Molecular Formula | C24H62O6Si6 |
| Molecular Weight | 615.25800 |
| Flash Point | 118.3ºC |
| Exact Mass | 614.31600 |
| PSA | 55.38000 |
| LogP | 7.56980 |
| Vapour Pressure | 0.00622mmHg at 25°C |
| Index of Refraction | 1.595 |
| InChIKey | USBJDBWAPKNPCK-NVPYSNMXSA-N |
| SMILES | C[Si](C)(C)OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C(CO[Si](C)(C)C)O[Si](C)(C)C |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| 1,2,3,4,5,6-hexa-O-trimethylsilyl-D-mannitol |
| hexakis-O-trimethylsilanyl-D-mannitol |
| trimethylsilyl ether of mannitol |
| Hexakis-O-trimethylsilyl-D-mannit |
| Trimethylsilyldulcitol |
| Hexa-O-trimethylsilyl-mannitol |
| D-manno-1,2,3,4,5,6-Hexakis-trimethylsilyloxy-hexan |