N,N’-Diacetyl-N,N'-1,4-Phenylenedi-glycine Diethyl Ester structure
|
Common Name | N,N’-Diacetyl-N,N'-1,4-Phenylenedi-glycine Diethyl Ester | ||
|---|---|---|---|---|
| CAS Number | 189194-00-1 | Molecular Weight | 364.39300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H24N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N,N’-Diacetyl-N,N’-1,4-Phenylenedi-glycine Diethyl Ester |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H24N2O6 |
|---|---|
| Molecular Weight | 364.39300 |
| Exact Mass | 364.16300 |
| PSA | 93.22000 |
| LogP | 1.51860 |
| InChIKey | XCQLTLHHIANKDB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CN(C(C)=O)c1ccc(N(CC(=O)OCC)C(C)=O)cc1 |
|
~%
N,N’-Diacetyl-N... CAS#:189194-00-1 |
| Literature: Namiki; Arai; Fujimori Journal of the American Chemical Society, 1997 , vol. 119, # 16 p. 3840 - 3841 |
| ethyl 2-[N-acetyl-4-[acetyl-(2-ethoxy-2-oxoethyl)amino]anilino]acetate |