1,3,3,4,4,5,5-heptafluorocyclopentene structure
|
Common Name | 1,3,3,4,4,5,5-heptafluorocyclopentene | ||
|---|---|---|---|---|
| CAS Number | 1892-03-1 | Molecular Weight | 194.05000 | |
| Density | 1.565g/cm3 | Boiling Point | 25.703ºC at 760 mmHg | |
| Molecular Formula | C5HF7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | -24.119ºC | |
| Name | 1,3,3,4,4,5,5-heptafluorocyclopentene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.565g/cm3 |
|---|---|
| Boiling Point | 25.703ºC at 760 mmHg |
| Molecular Formula | C5HF7 |
| Molecular Weight | 194.05000 |
| Flash Point | -24.119ºC |
| Exact Mass | 193.99700 |
| LogP | 2.75930 |
| Vapour Pressure | 741.185mmHg at 25°C |
| Index of Refraction | 1.307 |
| InChIKey | AWDCOETZVBNIIV-UHFFFAOYSA-N |
| SMILES | FC1=CC(F)(F)C(F)(F)C1(F)F |
| HS Code | 2903890090 |
|---|
|
~%
1,3,3,4,4,5,5-h... CAS#:1892-03-1
Detail
|
| Literature: Camaggi,G. et al. Tetrahedron, 1966 , vol. 22, p. 1755 - 1763 |
|
~%
1,3,3,4,4,5,5-h... CAS#:1892-03-1 |
| Literature: Camaggi,G. et al. Tetrahedron, 1966 , vol. 22, p. 1755 - 1763 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2903890090 |
|---|---|
| Summary | 2903890090. halogenated derivatives of cyclanic, cyclenic or cyclotherpenic hydrocarbons. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
| PC6813 |
| 1H-heptafluorocyclopentene |
| 1H-perfluorocyclopentene |
| 1-hydroperfluorocyclopentene |
| 1-Hydro-heptafluor-cyclopenten |
| 1-H-Heptafluorcyclopenten |
| 1,3,3,4,4,5,5-heptafluorocyclopent-1-ene |
| Cyclopentene,1,3,3,4,4,5,5-heptafluoro |
| 1,3,3,4,4,5,5-Heptafluor-cyclopenten |