3-{3-[(difluoromethyl)sulfanyl]phenyl}-1-methyl-1H-pyrazol-5-amine
Modify Date: 2026-07-12 19:49:42
![3-{3-[(difluoromethyl)sulfanyl]phenyl}-1-methyl-1H-pyrazol-5-amine Structure](https://www.chemsrc.com/extcaspic/077/1892083-53-2.png)
3-{3-[(difluoromethyl)sulfanyl]phenyl}-1-methyl-1H-pyrazol-5-amine structure
|
Common Name | 3-{3-[(difluoromethyl)sulfanyl]phenyl}-1-methyl-1H-pyrazol-5-amine | ||
|---|---|---|---|---|
| CAS Number | 1892083-53-2 | Molecular Weight | 255.29 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H11F2N3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-{3-[(difluoromethyl)sulfanyl]phenyl}-1-methyl-1H-pyrazol-5-amine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H11F2N3S |
|---|---|
| Molecular Weight | 255.29 |
| InChIKey | OPHHDDXLBWVYFE-UHFFFAOYSA-N |
| SMILES | Cn1nc(-c2cccc(SC(F)F)c2)cc1N |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 1892083-53-2? |
| A: Chinese name of 1892083-53-2 is 1892083-53-2. |
| Q: What is the English name of 3-{3-[(difluoromethyl)sulfanyl]phenyl}-1-methyl-1H-pyrazol-5-amine? |
| A: The English name of 3-{3-[(difluoromethyl)sulfanyl]phenyl}-1-methyl-1H-pyrazol-5-amine is 3-{3-[(difluoromethyl)sulfanyl]phenyl}-1-methyl-1H-pyrazol-5-amine. |
| Q: What is the molecular weight of 3-{3-[(difluoromethyl)sulfanyl]phenyl}-1-methyl-1H-pyrazol-5-amine? |
| A: Molecular weight of 3-{3-[(difluoromethyl)sulfanyl]phenyl}-1-methyl-1H-pyrazol-5-amine is 255.29. |
| Q: What is the molecular formula of 3-{3-[(difluoromethyl)sulfanyl]phenyl}-1-methyl-1H-pyrazol-5-amine? |
| A: Molecular formula of 3-{3-[(difluoromethyl)sulfanyl]phenyl}-1-methyl-1H-pyrazol-5-amine is C11H11F2N3S. |
| Q: What is the SMILES notation of 3-{3-[(difluoromethyl)sulfanyl]phenyl}-1-methyl-1H-pyrazol-5-amine? |
| A: SMILES notation of 3-{3-[(difluoromethyl)sulfanyl]phenyl}-1-methyl-1H-pyrazol-5-amine is Cn1nc(-c2cccc(SC(F)F)c2)cc1N. |
| Q: What is the InChIKey of 3-{3-[(difluoromethyl)sulfanyl]phenyl}-1-methyl-1H-pyrazol-5-amine? |
| A: InChIKey of 3-{3-[(difluoromethyl)sulfanyl]phenyl}-1-methyl-1H-pyrazol-5-amine is OPHHDDXLBWVYFE-UHFFFAOYSA-N. |
| Q: What is the CAS number of 3-{3-[(difluoromethyl)sulfanyl]phenyl}-1-methyl-1H-pyrazol-5-amine? |
| A: CAS number of 3-{3-[(difluoromethyl)sulfanyl]phenyl}-1-methyl-1H-pyrazol-5-amine is 1892083-53-2. |