L-Norvaline,N-[N-[(phenylmethoxy)carbonyl]-L-alanyl]- (9CI)
Modify Date: 2025-10-01 07:22:09
![L-Norvaline,N-[N-[(phenylmethoxy)carbonyl]-L-alanyl]- (9CI) Structure](https://image.chemsrc.com/caspic/291/18921-54-5.png)
L-Norvaline,N-[N-[(phenylmethoxy)carbonyl]-L-alanyl]- (9CI) structure
|
Common Name | L-Norvaline,N-[N-[(phenylmethoxy)carbonyl]-L-alanyl]- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 18921-54-5 | Molecular Weight | 322.35600 | |
| Density | 1.203g/cm3 | Boiling Point | 582ºC at 760 mmHg | |
| Molecular Formula | C16H22N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 305.8ºC | |
| Name | 2-[2-(phenylmethoxycarbonylamino)propanoylamino]pentanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.203g/cm3 |
|---|---|
| Boiling Point | 582ºC at 760 mmHg |
| Molecular Formula | C16H22N2O5 |
| Molecular Weight | 322.35600 |
| Flash Point | 305.8ºC |
| Exact Mass | 322.15300 |
| PSA | 104.73000 |
| LogP | 2.45260 |
| Vapour Pressure | 2.17E-14mmHg at 25°C |
| Index of Refraction | 1.534 |
| InChIKey | LDWKLEOJLPWEIE-UHFFFAOYSA-N |
| SMILES | CCCC(NC(=O)C(C)NC(=O)OCc1ccccc1)C(=O)O |
| HS Code | 2924299090 |
|---|
|
~%
L-Norvaline,N-[... CAS#:18921-54-5 |
| Literature: Fu et al. Journal of the American Chemical Society, 1954 , vol. 76, p. 6054,6057 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-(N-benzyloxycarbonyl-L-alanyl)-L-norvaline |
| 2-(2-{[(benzyloxy)carbonyl]amino}propanamido)pentanoic acid |
| Benzyloxycarbonyl-Ala-Nva |