2-(4-Nitrophenyl)-2H-1,2,3-triazole structure
|
Common Name | 2-(4-Nitrophenyl)-2H-1,2,3-triazole | ||
|---|---|---|---|---|
| CAS Number | 18922-72-0 | Molecular Weight | 190.15900 | |
| Density | 1.46g/cm3 | Boiling Point | 380.7ºC at 760 mmHg | |
| Molecular Formula | C8H6N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 184ºC | |
| Name | 2-(4-nitrophenyl)triazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.46g/cm3 |
|---|---|
| Boiling Point | 380.7ºC at 760 mmHg |
| Molecular Formula | C8H6N4O2 |
| Molecular Weight | 190.15900 |
| Flash Point | 184ºC |
| Exact Mass | 190.04900 |
| PSA | 76.53000 |
| LogP | 1.69870 |
| Vapour Pressure | 5.35E-06mmHg at 25°C |
| Index of Refraction | 1.696 |
| InChIKey | DAIISCIHCDYWAF-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(-n2nccn2)cc1 |
| HS Code | 2933990090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-<4-Nitro-phenyl>-1.2.3-2H-triazol |