{1-[3-Fluoro-5-(trifluoromethyl)phenyl]cyclohexyl}methanamine
Modify Date: 2026-09-22 10:52:14
![{1-[3-Fluoro-5-(trifluoromethyl)phenyl]cyclohexyl}methanamine Structure](https://www.chemsrc.com/extcaspic/482/1892432-72-2.png)
{1-[3-Fluoro-5-(trifluoromethyl)phenyl]cyclohexyl}methanamine structure
|
Common Name | {1-[3-Fluoro-5-(trifluoromethyl)phenyl]cyclohexyl}methanamine | ||
|---|---|---|---|---|
| CAS Number | 1892432-72-2 | Molecular Weight | 275.28 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H17F4N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | {1-[3-Fluoro-5-(trifluoromethyl)phenyl]cyclohexyl}methanamine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H17F4N |
|---|---|
| Molecular Weight | 275.28 |
| InChIKey | QABPFKPSJUEDDQ-UHFFFAOYSA-N |
| SMILES | NCC1(c2cc(F)cc(C(F)(F)F)c2)CCCCC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of {1-[3-Fluoro-5-(trifluoromethyl)phenyl]cyclohexyl}methanamine? |
| A: SMILES notation of {1-[3-Fluoro-5-(trifluoromethyl)phenyl]cyclohexyl}methanamine is NCC1(c2cc(F)cc(C(F)(F)F)c2)CCCCC1. |
| Q: What is the molecular formula of {1-[3-Fluoro-5-(trifluoromethyl)phenyl]cyclohexyl}methanamine? |
| A: Molecular formula of {1-[3-Fluoro-5-(trifluoromethyl)phenyl]cyclohexyl}methanamine is C14H17F4N. |
| Q: What is the English name of {1-[3-Fluoro-5-(trifluoromethyl)phenyl]cyclohexyl}methanamine? |
| A: The English name of {1-[3-Fluoro-5-(trifluoromethyl)phenyl]cyclohexyl}methanamine is {1-[3-Fluoro-5-(trifluoromethyl)phenyl]cyclohexyl}methanamine. |
| Q: What is the Chinese name of 1892432-72-2? |
| A: Chinese name of 1892432-72-2 is 1892432-72-2. |
| Q: What is the molecular weight of {1-[3-Fluoro-5-(trifluoromethyl)phenyl]cyclohexyl}methanamine? |
| A: Molecular weight of {1-[3-Fluoro-5-(trifluoromethyl)phenyl]cyclohexyl}methanamine is 275.28. |
| Q: What is the CAS number of {1-[3-Fluoro-5-(trifluoromethyl)phenyl]cyclohexyl}methanamine? |
| A: CAS number of {1-[3-Fluoro-5-(trifluoromethyl)phenyl]cyclohexyl}methanamine is 1892432-72-2. |
| Q: What is the InChIKey of {1-[3-Fluoro-5-(trifluoromethyl)phenyl]cyclohexyl}methanamine? |
| A: InChIKey of {1-[3-Fluoro-5-(trifluoromethyl)phenyl]cyclohexyl}methanamine is QABPFKPSJUEDDQ-UHFFFAOYSA-N. |