N,N,2-trimethyl-3-oxobutane-2-sulfonamide structure
|
Common Name | N,N,2-trimethyl-3-oxobutane-2-sulfonamide | ||
|---|---|---|---|---|
| CAS Number | 1892464-75-3 | Molecular Weight | 193.27 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H15NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N,N,2-trimethyl-3-oxobutane-2-sulfonamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C7H15NO3S |
|---|---|
| Molecular Weight | 193.27 |
| InChIKey | LRJWGSFZZVOUCL-UHFFFAOYSA-N |
| SMILES | CC(=O)C(C)(C)S(=O)(=O)N(C)C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of N,N,2-trimethyl-3-oxobutane-2-sulfonamide? |
| A: CAS number of N,N,2-trimethyl-3-oxobutane-2-sulfonamide is 1892464-75-3. |
| Q: What is the molecular formula of N,N,2-trimethyl-3-oxobutane-2-sulfonamide? |
| A: Molecular formula of N,N,2-trimethyl-3-oxobutane-2-sulfonamide is C7H15NO3S. |
| Q: What is the InChIKey of N,N,2-trimethyl-3-oxobutane-2-sulfonamide? |
| A: InChIKey of N,N,2-trimethyl-3-oxobutane-2-sulfonamide is LRJWGSFZZVOUCL-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of N,N,2-trimethyl-3-oxobutane-2-sulfonamide? |
| A: SMILES notation of N,N,2-trimethyl-3-oxobutane-2-sulfonamide is CC(=O)C(C)(C)S(=O)(=O)N(C)C. |
| Q: What is the English name of N,N,2-trimethyl-3-oxobutane-2-sulfonamide? |
| A: The English name of N,N,2-trimethyl-3-oxobutane-2-sulfonamide is N,N,2-trimethyl-3-oxobutane-2-sulfonamide. |
| Q: What is the Chinese name of 1892464-75-3? |
| A: Chinese name of 1892464-75-3 is 1892464-75-3. |
| Q: What is the molecular weight of N,N,2-trimethyl-3-oxobutane-2-sulfonamide? |
| A: Molecular weight of N,N,2-trimethyl-3-oxobutane-2-sulfonamide is 193.27. |