9-Benzyl-3,9-diazaspiro[5.5]undecane-2,4-dione structure
|
Common Name | 9-Benzyl-3,9-diazaspiro[5.5]undecane-2,4-dione | ||
|---|---|---|---|---|
| CAS Number | 189333-48-0 | Molecular Weight | 272.34200 | |
| Density | 1.2g/cm3 | Boiling Point | 458.4ºC at 760 mmHg | |
| Molecular Formula | C16H20N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 231ºC | |
| Name | 9-Benzyl-3,9-diazaspiro[5.5]undecane-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2g/cm3 |
|---|---|
| Boiling Point | 458.4ºC at 760 mmHg |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.34200 |
| Flash Point | 231ºC |
| Exact Mass | 272.15200 |
| PSA | 49.41000 |
| LogP | 1.97210 |
| Vapour Pressure | 1.38E-08mmHg at 25°C |
| Index of Refraction | 1.597 |
| InChIKey | MZOUQZZYZKEBKL-UHFFFAOYSA-N |
| SMILES | O=C1CC2(CCN(Cc3ccccc3)CC2)CC(=O)N1 |
| HS Code | 2933990090 |
|---|
|
~%
9-Benzyl-3,9-di... CAS#:189333-48-0 |
| Literature: US2008/247964 A1, ; Page/Page column 28 ; US 20080247964 A1 |
|
~%
9-Benzyl-3,9-di... CAS#:189333-48-0 |
| Literature: WO2006/44504 A1, ; Page/Page column 97 ; WO 2006/044504 A1 |
|
~%
9-Benzyl-3,9-di... CAS#:189333-48-0 |
| Literature: EP2557082 A1, ; |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| MFCD11040245 |