(4R)-N-tert-butyl-3-[(2S,3S)-3-[[2-(2,6-dimethylphenoxy)acetyl]amino]-2-hydroxy-4-phenylbutanoyl]-5,5-dimethyl-1,3-thiazolidine-4-carboxamide structure
|
Common Name | (4R)-N-tert-butyl-3-[(2S,3S)-3-[[2-(2,6-dimethylphenoxy)acetyl]amino]-2-hydroxy-4-phenylbutanoyl]-5,5-dimethyl-1,3-thiazolidine-4-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 189357-33-3 | Molecular Weight | 555.72900 | |
| Density | 1.181g/cm3 | Boiling Point | 829.6ºC at 760mmHg | |
| Molecular Formula | C30H41N3O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 455.6ºC | |
| Name | (4R)-N-tert-butyl-3-[(2S,3S)-3-[[2-(2,6-dimethylphenoxy)acetyl]amino]-2-hydroxy-4-phenylbutanoyl]-5,5-dimethyl-1,3-thiazolidine-4-carboxamide |
|---|
| Density | 1.181g/cm3 |
|---|---|
| Boiling Point | 829.6ºC at 760mmHg |
| Molecular Formula | C30H41N3O5S |
| Molecular Weight | 555.72900 |
| Flash Point | 455.6ºC |
| Exact Mass | 555.27700 |
| PSA | 140.25000 |
| LogP | 4.98390 |
| Vapour Pressure | 3.61E-29mmHg at 25°C |
| Index of Refraction | 1.571 |
| InChIKey | CSWRAOHDICNMPU-LLZJGCNPSA-N |
| SMILES | Cc1cccc(C)c1OCC(=O)NC(Cc1ccccc1)C(O)C(=O)N1CSC(C)(C)C1C(=O)NC(C)(C)C |
|
Name: Inhibition of HIV1 recombinant protease at 50 nM after 15 mins by fluorescence assay
Source: ChEMBL
Target: Protease
External Id: CHEMBL1037774
|
|
Name: Ratio of EC50 for HIV1 3B infected in human MT4 cells in presence of 50% human serum ...
Source: ChEMBL
Target: Human immunodeficiency virus 1
External Id: CHEMBL1037781
|
|
Name: Antiviral activity against HIV1 3B infected in human MT4 cells assessed as inhibition...
Source: ChEMBL
Target: Human immunodeficiency virus 1
External Id: CHEMBL1037779
|
|
Name: Antiviral activity against HIV1 3B infected in human MT4 cells assessed as inhibition...
Source: ChEMBL
Target: Human immunodeficiency virus 1
External Id: CHEMBL1037777
|