tert-butyl-[(3S)-1-hydroxypyrrolidin-3-yl]oxy-dimethylsilane structure
|
Common Name | tert-butyl-[(3S)-1-hydroxypyrrolidin-3-yl]oxy-dimethylsilane | ||
|---|---|---|---|---|
| CAS Number | 189368-35-2 | Molecular Weight | 217.38100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H23NO2Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | tert-butyl-[(3S)-1-hydroxypyrrolidin-3-yl]oxy-dimethylsilane |
|---|
| Molecular Formula | C10H23NO2Si |
|---|---|
| Molecular Weight | 217.38100 |
| Exact Mass | 217.15000 |
| PSA | 32.70000 |
| LogP | 2.40960 |
| InChIKey | IFCCXMVZUDFCOE-VIFPVBQESA-N |
| SMILES | CC(C)(C)[Si](C)(C)OC1CCN(O)C1 |
|
~%
tert-butyl-[(3S... CAS#:189368-35-2 |
| Literature: Goti, Andrea; Cicchi, Stefano; Fedi, Valentina; Nannelli, Luca; Brandi, Alberto Journal of Organic Chemistry, 1997 , vol. 62, # 10 p. 3119 - 3125 |
|
~%
tert-butyl-[(3S... CAS#:189368-35-2 |
| Literature: Goti, Andrea; Cicchi, Stefano; Fedi, Valentina; Nannelli, Luca; Brandi, Alberto Journal of Organic Chemistry, 1997 , vol. 62, # 10 p. 3119 - 3125 |