{1-[(2,3-Dihydro-1-benzofuran-5-yl)methyl]cyclobutyl}methanamine structure
|
Common Name | {1-[(2,3-Dihydro-1-benzofuran-5-yl)methyl]cyclobutyl}methanamine | ||
|---|---|---|---|---|
| CAS Number | 1894322-56-5 | Molecular Weight | 217.31 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H19NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | {1-[(2,3-Dihydro-1-benzofuran-5-yl)methyl]cyclobutyl}methanamine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H19NO |
|---|---|
| Molecular Weight | 217.31 |
| InChIKey | CRUNWLBPCUCPSR-UHFFFAOYSA-N |
| SMILES | NCC1(Cc2ccc3c(c2)CCO3)CCC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 1894322-56-5? |
| A: Chinese name of 1894322-56-5 is 1894322-56-5. |
| Q: What is the molecular weight of {1-[(2,3-Dihydro-1-benzofuran-5-yl)methyl]cyclobutyl}methanamine? |
| A: Molecular weight of {1-[(2,3-Dihydro-1-benzofuran-5-yl)methyl]cyclobutyl}methanamine is 217.31. |
| Q: What is the molecular formula of {1-[(2,3-Dihydro-1-benzofuran-5-yl)methyl]cyclobutyl}methanamine? |
| A: Molecular formula of {1-[(2,3-Dihydro-1-benzofuran-5-yl)methyl]cyclobutyl}methanamine is C14H19NO. |
| Q: What is the English name of {1-[(2,3-Dihydro-1-benzofuran-5-yl)methyl]cyclobutyl}methanamine? |
| A: The English name of {1-[(2,3-Dihydro-1-benzofuran-5-yl)methyl]cyclobutyl}methanamine is {1-[(2,3-Dihydro-1-benzofuran-5-yl)methyl]cyclobutyl}methanamine. |
| Q: What is the SMILES notation of {1-[(2,3-Dihydro-1-benzofuran-5-yl)methyl]cyclobutyl}methanamine? |
| A: SMILES notation of {1-[(2,3-Dihydro-1-benzofuran-5-yl)methyl]cyclobutyl}methanamine is NCC1(Cc2ccc3c(c2)CCO3)CCC1. |
| Q: What is the CAS number of {1-[(2,3-Dihydro-1-benzofuran-5-yl)methyl]cyclobutyl}methanamine? |
| A: CAS number of {1-[(2,3-Dihydro-1-benzofuran-5-yl)methyl]cyclobutyl}methanamine is 1894322-56-5. |
| Q: What is the InChIKey of {1-[(2,3-Dihydro-1-benzofuran-5-yl)methyl]cyclobutyl}methanamine? |
| A: InChIKey of {1-[(2,3-Dihydro-1-benzofuran-5-yl)methyl]cyclobutyl}methanamine is CRUNWLBPCUCPSR-UHFFFAOYSA-N. |