Propanamide, N-(5-bromo-2-thienyl)-N,2-dimethyl-2-(methylamino)
Modify Date: 2026-08-17 11:34:14
Propanamide, N-(5-bromo-2-thienyl)-N,2-dimethyl-2-(methylamino) structure
|
Common Name | Propanamide, N-(5-bromo-2-thienyl)-N,2-dimethyl-2-(methylamino) | ||
|---|---|---|---|---|
| CAS Number | 1894628-50-2 | Molecular Weight | 291.21 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H15BrN2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Propanamide, N-(5-bromo-2-thienyl)-N,2-dimethyl-2-(methylamino) |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H15BrN2OS |
|---|---|
| Molecular Weight | 291.21 |
| InChIKey | SYDSTDSVGDRJSN-UHFFFAOYSA-N |
| SMILES | CNC(C)(C)C(=O)N(C)c1ccc(Br)s1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of Propanamide, N-(5-bromo-2-thienyl)-N,2-dimethyl-2-(methylamino)? |
| A: CAS number of Propanamide, N-(5-bromo-2-thienyl)-N,2-dimethyl-2-(methylamino) is 1894628-50-2. |
| Q: What is the InChIKey of Propanamide, N-(5-bromo-2-thienyl)-N,2-dimethyl-2-(methylamino)? |
| A: InChIKey of Propanamide, N-(5-bromo-2-thienyl)-N,2-dimethyl-2-(methylamino) is SYDSTDSVGDRJSN-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of Propanamide, N-(5-bromo-2-thienyl)-N,2-dimethyl-2-(methylamino)? |
| A: SMILES notation of Propanamide, N-(5-bromo-2-thienyl)-N,2-dimethyl-2-(methylamino) is CNC(C)(C)C(=O)N(C)c1ccc(Br)s1. |
| Q: What is the molecular formula of Propanamide, N-(5-bromo-2-thienyl)-N,2-dimethyl-2-(methylamino)? |
| A: Molecular formula of Propanamide, N-(5-bromo-2-thienyl)-N,2-dimethyl-2-(methylamino) is C10H15BrN2OS. |
| Q: What is the English name of Propanamide, N-(5-bromo-2-thienyl)-N,2-dimethyl-2-(methylamino)? |
| A: The English name of Propanamide, N-(5-bromo-2-thienyl)-N,2-dimethyl-2-(methylamino) is Propanamide, N-(5-bromo-2-thienyl)-N,2-dimethyl-2-(methylamino). |
| Q: What is the molecular weight of Propanamide, N-(5-bromo-2-thienyl)-N,2-dimethyl-2-(methylamino)? |
| A: Molecular weight of Propanamide, N-(5-bromo-2-thienyl)-N,2-dimethyl-2-(methylamino) is 291.21. |
| Q: What is the Chinese name of 1894628-50-2? |
| A: Chinese name of 1894628-50-2 is 1894628-50-2. |