N-[[(3Z)-1,3-bis(methyl-phenyl-hydrazinylidene)propan-2-ylidene]amino]-N-methyl-aniline structure
|
Common Name | N-[[(3Z)-1,3-bis(methyl-phenyl-hydrazinylidene)propan-2-ylidene]amino]-N-methyl-aniline | ||
|---|---|---|---|---|
| CAS Number | 18952-66-4 | Molecular Weight | 398.50300 | |
| Density | 1.057g/cm3 | Boiling Point | 526.414ºC at 760 mmHg | |
| Molecular Formula | C24H26N6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 272.165ºC | |
| Name | N-[2,3-bis[methyl(phenyl)hydrazinylidene]propylideneamino]-N-methylaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.057g/cm3 |
|---|---|
| Boiling Point | 526.414ºC at 760 mmHg |
| Molecular Formula | C24H26N6 |
| Molecular Weight | 398.50300 |
| Flash Point | 272.165ºC |
| Exact Mass | 398.22200 |
| PSA | 46.80000 |
| LogP | 4.72320 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.583 |
| InChIKey | LNTNHRWHOBVRQC-FQHZWJPGSA-N |
| SMILES | CN(N=CC(C=NN(C)c1ccccc1)=NN(C)c1ccccc1)c1ccccc1 |
|
~%
N-[[(3Z)-1,3-bi... CAS#:18952-66-4 |
| Literature: Chapman,O.L. et al. Journal of the American Chemical Society, 1964 , vol. 86, p. 732 - 733 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Propanondial |
| Oxopropandial |
| Trimethyleneoxide/Oxetane |
| Mesoxalaldehyd |
| Mesoxaldialdehyde |
| MESOXALALDEHYDE |
| Mesoxalaldehyd-tris-(methyl-phenyl-hydrazon) |
| Oxomalonaldehyde |
| Mesoxaldialdehyd-1,2,3-tris-methylphenylhydrazon |
| 1,2,3-Propanetrione |
| (1,3-Dihydroxy-aceton)-methylphenylalkazon |
| Mesoxaldialdehyd |
| Oxopropanedial |
| mesoxalaldehyde tris-(methyl-phenyl-hydrazone) |
| Trioxo-propan |