1H-Indole, 7-chloro-2-[(4-fluorophenoxy)methyl]-1-(1-methylethyl)
Modify Date: 2026-07-21 21:40:32
![1H-Indole, 7-chloro-2-[(4-fluorophenoxy)methyl]-1-(1-methylethyl) Structure](https://www.chemsrc.com/extcaspic/215/1895200-00-6.png)
1H-Indole, 7-chloro-2-[(4-fluorophenoxy)methyl]-1-(1-methylethyl) structure
|
Common Name | 1H-Indole, 7-chloro-2-[(4-fluorophenoxy)methyl]-1-(1-methylethyl) | ||
|---|---|---|---|---|
| CAS Number | 1895200-00-6 | Molecular Weight | 317.8 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H17ClFNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1H-Indole, 7-chloro-2-[(4-fluorophenoxy)methyl]-1-(1-methylethyl) |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C18H17ClFNO |
|---|---|
| Molecular Weight | 317.8 |
| InChIKey | ZABCXQRMEGCIMI-UHFFFAOYSA-N |
| SMILES | CC(C)n1c(COc2ccc(F)cc2)cc2cccc(Cl)c21 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 1895200-00-6? |
| A: Chinese name of 1895200-00-6 is 1895200-00-6. |
| Q: What is the InChIKey of 1H-Indole, 7-chloro-2-[(4-fluorophenoxy)methyl]-1-(1-methylethyl)? |
| A: InChIKey of 1H-Indole, 7-chloro-2-[(4-fluorophenoxy)methyl]-1-(1-methylethyl) is ZABCXQRMEGCIMI-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 1H-Indole, 7-chloro-2-[(4-fluorophenoxy)methyl]-1-(1-methylethyl)? |
| A: Molecular formula of 1H-Indole, 7-chloro-2-[(4-fluorophenoxy)methyl]-1-(1-methylethyl) is C18H17ClFNO. |
| Q: What is the SMILES notation of 1H-Indole, 7-chloro-2-[(4-fluorophenoxy)methyl]-1-(1-methylethyl)? |
| A: SMILES notation of 1H-Indole, 7-chloro-2-[(4-fluorophenoxy)methyl]-1-(1-methylethyl) is CC(C)n1c(COc2ccc(F)cc2)cc2cccc(Cl)c21. |
| Q: What is the molecular weight of 1H-Indole, 7-chloro-2-[(4-fluorophenoxy)methyl]-1-(1-methylethyl)? |
| A: Molecular weight of 1H-Indole, 7-chloro-2-[(4-fluorophenoxy)methyl]-1-(1-methylethyl) is 317.8. |
| Q: What is the CAS number of 1H-Indole, 7-chloro-2-[(4-fluorophenoxy)methyl]-1-(1-methylethyl)? |
| A: CAS number of 1H-Indole, 7-chloro-2-[(4-fluorophenoxy)methyl]-1-(1-methylethyl) is 1895200-00-6. |
| Q: What is the English name of 1H-Indole, 7-chloro-2-[(4-fluorophenoxy)methyl]-1-(1-methylethyl)? |
| A: The English name of 1H-Indole, 7-chloro-2-[(4-fluorophenoxy)methyl]-1-(1-methylethyl) is 1H-Indole, 7-chloro-2-[(4-fluorophenoxy)methyl]-1-(1-methylethyl). |