3,8-Dimethyl-1,2-dihydroisoquinolin-1-one
Modify Date: 2025-09-09 16:15:32
3,8-Dimethyl-1,2-dihydroisoquinolin-1-one structure
|
Common Name | 3,8-Dimethyl-1,2-dihydroisoquinolin-1-one | ||
|---|---|---|---|---|
| CAS Number | 1895450-99-3 | Molecular Weight | 173.21 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H11NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3,8-Dimethyl-1,2-dihydroisoquinolin-1-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H11NO |
|---|---|
| Molecular Weight | 173.21 |
| InChIKey | LUQRVTCDNYQIOL-UHFFFAOYSA-N |
| SMILES | Cc1cc2cccc(C)c2c(=O)[nH]1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 3,8-Dimethyl-1,2-dihydroisoquinolin-1-one? |
| A: CAS number of 3,8-Dimethyl-1,2-dihydroisoquinolin-1-one is 1895450-99-3. |
| Q: What is the Chinese name of 1895450-99-3? |
| A: Chinese name of 1895450-99-3 is 1895450-99-3. |
| Q: What is the SMILES notation of 3,8-Dimethyl-1,2-dihydroisoquinolin-1-one? |
| A: SMILES notation of 3,8-Dimethyl-1,2-dihydroisoquinolin-1-one is Cc1cc2cccc(C)c2c(=O)[nH]1. |
| Q: What is the molecular weight of 3,8-Dimethyl-1,2-dihydroisoquinolin-1-one? |
| A: Molecular weight of 3,8-Dimethyl-1,2-dihydroisoquinolin-1-one is 173.21. |
| Q: What is the English name of 3,8-Dimethyl-1,2-dihydroisoquinolin-1-one? |
| A: The English name of 3,8-Dimethyl-1,2-dihydroisoquinolin-1-one is 3,8-Dimethyl-1,2-dihydroisoquinolin-1-one. |
| Q: What is the molecular formula of 3,8-Dimethyl-1,2-dihydroisoquinolin-1-one? |
| A: Molecular formula of 3,8-Dimethyl-1,2-dihydroisoquinolin-1-one is C11H11NO. |
| Q: What is the InChIKey of 3,8-Dimethyl-1,2-dihydroisoquinolin-1-one? |
| A: InChIKey of 3,8-Dimethyl-1,2-dihydroisoquinolin-1-one is LUQRVTCDNYQIOL-UHFFFAOYSA-N. |