Methyl 2-(2,5-dimethylphenyl)prop-2-enoate
Modify Date: 2025-09-09 22:44:55
Methyl 2-(2,5-dimethylphenyl)prop-2-enoate structure
|
Common Name | Methyl 2-(2,5-dimethylphenyl)prop-2-enoate | ||
|---|---|---|---|---|
| CAS Number | 1895732-51-0 | Molecular Weight | 190.24 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H14O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Methyl 2-(2,5-dimethylphenyl)prop-2-enoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H14O2 |
|---|---|
| Molecular Weight | 190.24 |
| InChIKey | ZVWYZYRJUYWKJG-UHFFFAOYSA-N |
| SMILES | C=C(C(=O)OC)c1cc(C)ccc1C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of Methyl 2-(2,5-dimethylphenyl)prop-2-enoate? |
| A: Molecular weight of Methyl 2-(2,5-dimethylphenyl)prop-2-enoate is 190.24. |
| Q: What is the Chinese name of 1895732-51-0? |
| A: Chinese name of 1895732-51-0 is 1895732-51-0. |
| Q: What is the CAS number of Methyl 2-(2,5-dimethylphenyl)prop-2-enoate? |
| A: CAS number of Methyl 2-(2,5-dimethylphenyl)prop-2-enoate is 1895732-51-0. |
| Q: What is the molecular formula of Methyl 2-(2,5-dimethylphenyl)prop-2-enoate? |
| A: Molecular formula of Methyl 2-(2,5-dimethylphenyl)prop-2-enoate is C12H14O2. |
| Q: What is the SMILES notation of Methyl 2-(2,5-dimethylphenyl)prop-2-enoate? |
| A: SMILES notation of Methyl 2-(2,5-dimethylphenyl)prop-2-enoate is C=C(C(=O)OC)c1cc(C)ccc1C. |
| Q: What is the English name of Methyl 2-(2,5-dimethylphenyl)prop-2-enoate? |
| A: The English name of Methyl 2-(2,5-dimethylphenyl)prop-2-enoate is Methyl 2-(2,5-dimethylphenyl)prop-2-enoate. |
| Q: What is the InChIKey of Methyl 2-(2,5-dimethylphenyl)prop-2-enoate? |
| A: InChIKey of Methyl 2-(2,5-dimethylphenyl)prop-2-enoate is ZVWYZYRJUYWKJG-UHFFFAOYSA-N. |