methyl 2,4-dinitrobenzoate structure
|
Common Name | methyl 2,4-dinitrobenzoate | ||
|---|---|---|---|---|
| CAS Number | 18959-17-6 | Molecular Weight | 226.14300 | |
| Density | 1.497g/cm3 | Boiling Point | 357ºC at 760mmHg | |
| Molecular Formula | C8H6N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 174.1ºC | |
| Name | methyl 2,4-dinitrobenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.497g/cm3 |
|---|---|
| Boiling Point | 357ºC at 760mmHg |
| Molecular Formula | C8H6N2O6 |
| Molecular Weight | 226.14300 |
| Flash Point | 174.1ºC |
| Exact Mass | 226.02300 |
| PSA | 117.94000 |
| LogP | 2.33600 |
| Vapour Pressure | 2.8E-05mmHg at 25°C |
| Index of Refraction | 1.592 |
| InChIKey | WEUVWLHWKLGWBJ-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| HS Code | 2916399090 |
|---|
|
~%
methyl 2,4-dini... CAS#:18959-17-6 |
| Literature: Nozoe et al. Proceedings of the Japan Academy, 1950 , vol. 26, # 10 p. 36 Sci. Rep. Tohoku Univ., Ser. 1: Phys., Chem., Astron., 1957 , vol. 40, p. 130 |
|
~%
methyl 2,4-dini... CAS#:18959-17-6 |
| Literature: Haeussermann; Teichmann Journal fuer Praktische Chemie (Leipzig), 1895 , vol. <2> 52, p. 428 Anm. |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Benzoic acid,2,4-dinitro-,methyl ester |
| 2,4-Dinitro-benzoesaeure-methylester |
| 2,4-dinitro-benzoic acid methyl ester |
| EINECS 220-289-9 |