2-(Benzyloxy)tetrahydroimidazo[1,5-a]pyrazine-1,3(2H,5H)-dione
Modify Date: 2026-08-11 13:53:21
![2-(Benzyloxy)tetrahydroimidazo[1,5-a]pyrazine-1,3(2H,5H)-dione Structure](https://www.chemsrc.com/extcaspic/090/1895916-80-9.png)
2-(Benzyloxy)tetrahydroimidazo[1,5-a]pyrazine-1,3(2H,5H)-dione structure
|
Common Name | 2-(Benzyloxy)tetrahydroimidazo[1,5-a]pyrazine-1,3(2H,5H)-dione | ||
|---|---|---|---|---|
| CAS Number | 1895916-80-9 | Molecular Weight | 261.28 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H15N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(Benzyloxy)tetrahydroimidazo[1,5-a]pyrazine-1,3(2H,5H)-dione |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H15N3O3 |
|---|---|
| Molecular Weight | 261.28 |
| InChIKey | XRDJVAAKYZNVQR-UHFFFAOYSA-N |
| SMILES | O=C1C2CNCCN2C(=O)N1OCc1ccccc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 2-(Benzyloxy)tetrahydroimidazo[1,5-a]pyrazine-1,3(2H,5H)-dione? |
| A: The English name of 2-(Benzyloxy)tetrahydroimidazo[1,5-a]pyrazine-1,3(2H,5H)-dione is 2-(Benzyloxy)tetrahydroimidazo[1,5-a]pyrazine-1,3(2H,5H)-dione. |
| Q: What is the SMILES notation of 2-(Benzyloxy)tetrahydroimidazo[1,5-a]pyrazine-1,3(2H,5H)-dione? |
| A: SMILES notation of 2-(Benzyloxy)tetrahydroimidazo[1,5-a]pyrazine-1,3(2H,5H)-dione is O=C1C2CNCCN2C(=O)N1OCc1ccccc1. |
| Q: What is the InChIKey of 2-(Benzyloxy)tetrahydroimidazo[1,5-a]pyrazine-1,3(2H,5H)-dione? |
| A: InChIKey of 2-(Benzyloxy)tetrahydroimidazo[1,5-a]pyrazine-1,3(2H,5H)-dione is XRDJVAAKYZNVQR-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 2-(Benzyloxy)tetrahydroimidazo[1,5-a]pyrazine-1,3(2H,5H)-dione? |
| A: Molecular weight of 2-(Benzyloxy)tetrahydroimidazo[1,5-a]pyrazine-1,3(2H,5H)-dione is 261.28. |
| Q: What is the Chinese name of 1895916-80-9? |
| A: Chinese name of 1895916-80-9 is 1895916-80-9. |
| Q: What is the CAS number of 2-(Benzyloxy)tetrahydroimidazo[1,5-a]pyrazine-1,3(2H,5H)-dione? |
| A: CAS number of 2-(Benzyloxy)tetrahydroimidazo[1,5-a]pyrazine-1,3(2H,5H)-dione is 1895916-80-9. |
| Q: What is the molecular formula of 2-(Benzyloxy)tetrahydroimidazo[1,5-a]pyrazine-1,3(2H,5H)-dione? |
| A: Molecular formula of 2-(Benzyloxy)tetrahydroimidazo[1,5-a]pyrazine-1,3(2H,5H)-dione is C13H15N3O3. |