1-{[4-(2-Methylpropyl)phenyl]methyl}cyclopropan-1-amine structure
|
Common Name | 1-{[4-(2-Methylpropyl)phenyl]methyl}cyclopropan-1-amine | ||
|---|---|---|---|---|
| CAS Number | 1896265-87-4 | Molecular Weight | 203.32 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H21N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-{[4-(2-Methylpropyl)phenyl]methyl}cyclopropan-1-amine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H21N |
|---|---|
| Molecular Weight | 203.32 |
| InChIKey | JYIRQISSBRECQF-UHFFFAOYSA-N |
| SMILES | CC(C)Cc1ccc(CC2(N)CC2)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 1-{[4-(2-Methylpropyl)phenyl]methyl}cyclopropan-1-amine? |
| A: CAS number of 1-{[4-(2-Methylpropyl)phenyl]methyl}cyclopropan-1-amine is 1896265-87-4. |
| Q: What is the molecular weight of 1-{[4-(2-Methylpropyl)phenyl]methyl}cyclopropan-1-amine? |
| A: Molecular weight of 1-{[4-(2-Methylpropyl)phenyl]methyl}cyclopropan-1-amine is 203.32. |
| Q: What is the Chinese name of 1896265-87-4? |
| A: Chinese name of 1896265-87-4 is 1896265-87-4. |
| Q: What is the English name of 1-{[4-(2-Methylpropyl)phenyl]methyl}cyclopropan-1-amine? |
| A: The English name of 1-{[4-(2-Methylpropyl)phenyl]methyl}cyclopropan-1-amine is 1-{[4-(2-Methylpropyl)phenyl]methyl}cyclopropan-1-amine. |
| Q: What is the molecular formula of 1-{[4-(2-Methylpropyl)phenyl]methyl}cyclopropan-1-amine? |
| A: Molecular formula of 1-{[4-(2-Methylpropyl)phenyl]methyl}cyclopropan-1-amine is C14H21N. |
| Q: What is the SMILES notation of 1-{[4-(2-Methylpropyl)phenyl]methyl}cyclopropan-1-amine? |
| A: SMILES notation of 1-{[4-(2-Methylpropyl)phenyl]methyl}cyclopropan-1-amine is CC(C)Cc1ccc(CC2(N)CC2)cc1. |
| Q: What is the InChIKey of 1-{[4-(2-Methylpropyl)phenyl]methyl}cyclopropan-1-amine? |
| A: InChIKey of 1-{[4-(2-Methylpropyl)phenyl]methyl}cyclopropan-1-amine is JYIRQISSBRECQF-UHFFFAOYSA-N. |