(3,4-dimethylphenyl)(1H-pyrazol-4-yl)methanol structure
|
Common Name | (3,4-dimethylphenyl)(1H-pyrazol-4-yl)methanol | ||
|---|---|---|---|---|
| CAS Number | 1896311-49-1 | Molecular Weight | 202.25 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H14N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (3,4-dimethylphenyl)(1H-pyrazol-4-yl)methanol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H14N2O |
|---|---|
| Molecular Weight | 202.25 |
| InChIKey | IOWHNUXNCPDBFT-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C(O)c2cn[nH]c2)cc1C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of (3,4-dimethylphenyl)(1H-pyrazol-4-yl)methanol? |
| A: Molecular formula of (3,4-dimethylphenyl)(1H-pyrazol-4-yl)methanol is C12H14N2O. |
| Q: What is the molecular weight of (3,4-dimethylphenyl)(1H-pyrazol-4-yl)methanol? |
| A: Molecular weight of (3,4-dimethylphenyl)(1H-pyrazol-4-yl)methanol is 202.25. |
| Q: What is the SMILES notation of (3,4-dimethylphenyl)(1H-pyrazol-4-yl)methanol? |
| A: SMILES notation of (3,4-dimethylphenyl)(1H-pyrazol-4-yl)methanol is Cc1ccc(C(O)c2cn[nH]c2)cc1C. |
| Q: What is the Chinese name of 1896311-49-1? |
| A: Chinese name of 1896311-49-1 is 1896311-49-1. |
| Q: What is the CAS number of (3,4-dimethylphenyl)(1H-pyrazol-4-yl)methanol? |
| A: CAS number of (3,4-dimethylphenyl)(1H-pyrazol-4-yl)methanol is 1896311-49-1. |
| Q: What is the InChIKey of (3,4-dimethylphenyl)(1H-pyrazol-4-yl)methanol? |
| A: InChIKey of (3,4-dimethylphenyl)(1H-pyrazol-4-yl)methanol is IOWHNUXNCPDBFT-UHFFFAOYSA-N. |
| Q: What is the English name of (3,4-dimethylphenyl)(1H-pyrazol-4-yl)methanol? |
| A: The English name of (3,4-dimethylphenyl)(1H-pyrazol-4-yl)methanol is (3,4-dimethylphenyl)(1H-pyrazol-4-yl)methanol. |