1-[(4-Carboxyphenyl)methyl]-2-methyl-1,2-hydrazinedicarboxylic acid bis(phenylmethyl) ester structure
|
Common Name | 1-[(4-Carboxyphenyl)methyl]-2-methyl-1,2-hydrazinedicarboxylic acid bis(phenylmethyl) ester | ||
|---|---|---|---|---|
| CAS Number | 18969-60-3 | Molecular Weight | 448.46800 | |
| Density | 1.304 | Boiling Point | N/A | |
| Molecular Formula | C25H24N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(2-{1,2-Bis[(benzyloxy)carbonyl]hydrazino}ethyl)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.304 |
|---|---|
| Molecular Formula | C25H24N2O6 |
| Molecular Weight | 448.46800 |
| Exact Mass | 448.16300 |
| PSA | 108.66000 |
| LogP | 4.61190 |
| InChIKey | SQVPOIYOTJPEAF-UHFFFAOYSA-N |
| SMILES | CN(C(=O)OCc1ccccc1)N(Cc1ccc(C(=O)O)cc1)C(=O)OCc1ccccc1 |
| HS Code | 2928000090 |
|---|
|
~%
1-[(4-Carboxyph... CAS#:18969-60-3 |
| Literature: Hoffmann-La Roche Patent: CH441366 , 1968 ; Chem.Abstr., 1968 , vol. 69, # 35691 |
|
~%
1-[(4-Carboxyph... CAS#:18969-60-3 |
| Literature: Hoffmann-La Roche Patent: US3830840US3931268 , 19741976 ; Chem.Abstr., 1976 , vol. 84, # 150385 |
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 4-<(2-Methyl-1,2-dicarbobenzoxy-hydrazino)-methyl>-benzoesaeure |
| 2-Methyl-N-ethyl-N-(2-cyanoethyl)-4-aminobenzaldehyde |
| 4-[(2-methyl-1,2-dicarbobenzoxy-hydrazino)-methyl]-benzoic acid |
| 4-<(2-Cyanoethyl)ethylamino>-o-tolualdehyde |
| 3-(ethyl(4-formyl-3-methylphenyl)amino)propanenitrile |
| 3-[ethyl(4-formyl-3-methylphenyl)amino]propiononitrile |