Bremelanotide PT 141 structure
|
Common Name | Bremelanotide PT 141 | ||
|---|---|---|---|---|
| CAS Number | 189691-06-3 | Molecular Weight | 1025.163 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C50H68N14O10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Bremelanotide PT 141Bremelanotide (PT-141) is an analogue of α-melanocyte-stimulating hormone (α-MSH). Bremelanotide activates the mPOA and other hypothalamic and limbic regions of the brain involved in sexual behavior. Bremelanotide can be used for researching hypoactive sexual desire disorders[1]. |
| Name | Bremelanotide |
|---|---|
| Synonym | More Synonyms |
| Description | Bremelanotide (PT-141) is an analogue of α-melanocyte-stimulating hormone (α-MSH). Bremelanotide activates the mPOA and other hypothalamic and limbic regions of the brain involved in sexual behavior. Bremelanotide can be used for researching hypoactive sexual desire disorders[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Molecular Formula | C50H68N14O10 |
| Molecular Weight | 1025.163 |
| Exact Mass | 1024.524292 |
| PSA | 376.47000 |
| LogP | -1.21 |
| Index of Refraction | 1.679 |
| InChIKey | FFHBJDQSGDNCIV-MFVUMRCOSA-N |
| SMILES | CCCCC(NC(C)=O)C(=O)NC1CC(=O)NCCCCC(C(=O)O)NC(=O)C(Cc2c[nH]c3ccccc23)NC(=O)C(CCCN=C(N)N)NC(=O)C(Cc2ccccc2)NC(=O)C(Cc2cnc[nH]2)NC1=O |
| PT141 Acetate |
| BreMelanotide Acetate |
| PT-141 |
| Bremelanotide PT 141 |
| 1,4,7,10,13,18-Hexaazacyclotricosane-23-carboxylic acid, 15-[[(2S)-2-(acetylamino)-1-oxohexyl]amino]-6-[3-[(aminoiminomethyl)amino]propyl]-12-(1H-imidazol-5-ylmethyl)-3-(1H-indol-3-ylmethyl)-2,5,8,11,14,17-hexaoxo-9-(phenylmethyl)-, (3S,6S,9R,12S,15S,23S)- |
| (3S,6S,9R,12S,15S,23S)-15-[(N-Acetyl-L-norleucyl)amino]-9-benzyl-6-(3-carbamimidamidopropyl)-12-(1H-imidazol-4-ylmethyl)-3-(1H-indol-3-ylmethyl)-2,5,8,11,14,17-hexaoxo-1,4,7,10,13,18-hexaazacyclotricosane-23-carboxylic acid |
| Brmelanotice |
| bremelanotide |