5-(2-Phenylphenyl)-1,2-oxazol-3-amine
Modify Date: 2026-08-14 22:22:32
5-(2-Phenylphenyl)-1,2-oxazol-3-amine structure
|
Common Name | 5-(2-Phenylphenyl)-1,2-oxazol-3-amine | ||
|---|---|---|---|---|
| CAS Number | 1897334-68-7 | Molecular Weight | 236.27 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H12N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-(2-Phenylphenyl)-1,2-oxazol-3-amine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H12N2O |
|---|---|
| Molecular Weight | 236.27 |
| InChIKey | PVOFOOZYNLMJSI-UHFFFAOYSA-N |
| SMILES | Nc1cc(-c2ccccc2-c2ccccc2)on1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 1897334-68-7? |
| A: Chinese name of 1897334-68-7 is 1897334-68-7. |
| Q: What is the English name of 5-(2-Phenylphenyl)-1,2-oxazol-3-amine? |
| A: The English name of 5-(2-Phenylphenyl)-1,2-oxazol-3-amine is 5-(2-Phenylphenyl)-1,2-oxazol-3-amine. |
| Q: What is the molecular weight of 5-(2-Phenylphenyl)-1,2-oxazol-3-amine? |
| A: Molecular weight of 5-(2-Phenylphenyl)-1,2-oxazol-3-amine is 236.27. |
| Q: What is the SMILES notation of 5-(2-Phenylphenyl)-1,2-oxazol-3-amine? |
| A: SMILES notation of 5-(2-Phenylphenyl)-1,2-oxazol-3-amine is Nc1cc(-c2ccccc2-c2ccccc2)on1. |
| Q: What is the CAS number of 5-(2-Phenylphenyl)-1,2-oxazol-3-amine? |
| A: CAS number of 5-(2-Phenylphenyl)-1,2-oxazol-3-amine is 1897334-68-7. |
| Q: What is the molecular formula of 5-(2-Phenylphenyl)-1,2-oxazol-3-amine? |
| A: Molecular formula of 5-(2-Phenylphenyl)-1,2-oxazol-3-amine is C15H12N2O. |
| Q: What is the InChIKey of 5-(2-Phenylphenyl)-1,2-oxazol-3-amine? |
| A: InChIKey of 5-(2-Phenylphenyl)-1,2-oxazol-3-amine is PVOFOOZYNLMJSI-UHFFFAOYSA-N. |