N-(3,4-dichloro-phenyl)-N'-(4-hydroxy-phenyl)-urea
Modify Date: 2025-12-08 17:29:01
N-(3,4-dichloro-phenyl)-N'-(4-hydroxy-phenyl)-urea structure
|
Common Name | N-(3,4-dichloro-phenyl)-N'-(4-hydroxy-phenyl)-urea | ||
|---|---|---|---|---|
| CAS Number | 18981-90-3 | Molecular Weight | 297.13700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H10Cl2N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-(3,4-dichloro-phenyl)-N'-(4-hydroxy-phenyl)-urea |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H10Cl2N2O2 |
|---|---|
| Molecular Weight | 297.13700 |
| Exact Mass | 296.01200 |
| PSA | 61.36000 |
| LogP | 4.48900 |
| InChIKey | ZBEMPBNOSDYHQH-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccc(O)cc1)Nc1ccc(Cl)c(Cl)c1 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| N-(3,4-Dichlor-phenyl)-N'-(4-hydroxy-phenyl)-harnstoff |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of N-(3,4-dichloro-phenyl)-N'-(4-hydroxy-phenyl)-urea? |
| A: CAS number of N-(3,4-dichloro-phenyl)-N'-(4-hydroxy-phenyl)-urea is 18981-90-3. |
| Q: What is the Chinese name of 18981-90-3? |
| A: Chinese name of 18981-90-3 is 18981-90-3. |
| Q: What is the molecular formula of N-(3,4-dichloro-phenyl)-N'-(4-hydroxy-phenyl)-urea? |
| A: Molecular formula of N-(3,4-dichloro-phenyl)-N'-(4-hydroxy-phenyl)-urea is C13H10Cl2N2O2. |
| Q: What is the SMILES notation of N-(3,4-dichloro-phenyl)-N'-(4-hydroxy-phenyl)-urea? |
| A: SMILES notation of N-(3,4-dichloro-phenyl)-N'-(4-hydroxy-phenyl)-urea is O=C(Nc1ccc(O)cc1)Nc1ccc(Cl)c(Cl)c1. |
| Q: What is the polar surface area (PSA) of N-(3,4-dichloro-phenyl)-N'-(4-hydroxy-phenyl)-urea? |
| A: Polar surface area (PSA) of N-(3,4-dichloro-phenyl)-N'-(4-hydroxy-phenyl)-urea is 61.36000. |
| Q: What English synonyms does N-(3,4-dichloro-phenyl)-N'-(4-hydroxy-phenyl)-urea have? |
| A: English synonyms of N-(3,4-dichloro-phenyl)-N'-(4-hydroxy-phenyl)-urea: N-(3,4-Dichlor-phenyl)-N'-(4-hydroxy-phenyl)-harnstoff. |
| Q: What is the InChIKey of N-(3,4-dichloro-phenyl)-N'-(4-hydroxy-phenyl)-urea? |
| A: InChIKey of N-(3,4-dichloro-phenyl)-N'-(4-hydroxy-phenyl)-urea is ZBEMPBNOSDYHQH-UHFFFAOYSA-N. |
| Q: What is the molecular weight of N-(3,4-dichloro-phenyl)-N'-(4-hydroxy-phenyl)-urea? |
| A: Molecular weight of N-(3,4-dichloro-phenyl)-N'-(4-hydroxy-phenyl)-urea is 297.13700. |
| Q: What is the LogP of N-(3,4-dichloro-phenyl)-N'-(4-hydroxy-phenyl)-urea? |
| A: LogP of N-(3,4-dichloro-phenyl)-N'-(4-hydroxy-phenyl)-urea is 4.48900. |
| Q: What is the English name of N-(3,4-dichloro-phenyl)-N'-(4-hydroxy-phenyl)-urea? |
| A: The English name of N-(3,4-dichloro-phenyl)-N'-(4-hydroxy-phenyl)-urea is N-(3,4-dichloro-phenyl)-N'-(4-hydroxy-phenyl)-urea. |