1-(2,3,4-trimethoxyphenyl)cycloheptene structure
|
Common Name | 1-(2,3,4-trimethoxyphenyl)cycloheptene | ||
|---|---|---|---|---|
| CAS Number | 189832-04-0 | Molecular Weight | 262.34400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H22O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(2,3,4-trimethoxyphenyl)cycloheptene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H22O3 |
|---|---|
| Molecular Weight | 262.34400 |
| Exact Mass | 262.15700 |
| PSA | 27.69000 |
| LogP | 4.05990 |
| InChIKey | GJJCDBAVAYEJSG-UHFFFAOYSA-N |
| SMILES | COc1ccc(C2=CCCCCC2)c(OC)c1OC |
|
~39%
1-(2,3,4-trimet... CAS#:189832-04-0 |
| Literature: Rohm and Haas Company Patent: US5866513 A1, 1999 ; |
|
~%
1-(2,3,4-trimet... CAS#:189832-04-0 |
| Literature: Lotspeich,F.J.; Core,S. Journal of Heterocyclic Chemistry, 1969 , vol. 6, p. 423 - 427 |
|
~%
1-(2,3,4-trimet... CAS#:189832-04-0 |
| Literature: Gutsche; Fleming Journal of the American Chemical Society, 1954 , vol. 76, p. 1771,1774 |
| HMS3085J06 |
| 1-cyclohept-1-enyl-2,3,4-trimethoxy-benzene |
| 1-Cyclohept-1-enyl-2,3,4-trimethoxy-benzol |
| 1-<2',3',4'-Trimethoxy-phenyl>-cyclohepten |