N-(anilino-phenyl-phosphinothioyl)aniline structure
|
Common Name | N-(anilino-phenyl-phosphinothioyl)aniline | ||
|---|---|---|---|---|
| CAS Number | 18995-01-2 | Molecular Weight | 324.38000 | |
| Density | 1.25g/cm3 | Boiling Point | 459.8ºC at 760 mmHg | |
| Molecular Formula | C18H17N2PS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 231.9ºC | |
| Name | N-[anilino(phenyl)phosphinothioyl]aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.25g/cm3 |
|---|---|
| Boiling Point | 459.8ºC at 760 mmHg |
| Molecular Formula | C18H17N2PS |
| Molecular Weight | 324.38000 |
| Flash Point | 231.9ºC |
| Exact Mass | 324.08500 |
| PSA | 65.96000 |
| LogP | 5.64220 |
| Vapour Pressure | 1.23E-08mmHg at 25°C |
| Index of Refraction | 1.672 |
| InChIKey | GZOIKJPNQRHEFN-UHFFFAOYSA-N |
| SMILES | S=P(Nc1ccccc1)(Nc1ccccc1)c1ccccc1 |
|
~89%
N-(anilino-phen... CAS#:18995-01-2 |
| Literature: Argent, Peter J.; Healy, James D.; Ibrahim, Ezzeldine H.; Shaw, Robert A.; Woods, Michael Phosphorus and Sulfur and the Related Elements, 1981 , vol. 12, p. 95 - 102 |
|
~%
N-(anilino-phen... CAS#:18995-01-2 |
| Literature: Kabatschnik; Godowikow Doklady Akademii Nauk SSSR, 1956 , vol. 110, p. 217 Doklady Chemistry, 106-111<1956>549 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| N-(anilino-phenyl-phosphinothioyl)aniline |
| phenyl-thiophosphonic acid-dianilide |
| n,n',p-triphenylphosphonothioic diamide |
| Phenyl-thiophosphonsaeure-dianilid |
| N,N'-Diphenyl-phenyl-thiophosphonsaeurediamid |