2-[2-[[3-(4-chlorophenyl)-8-methyl-8-azabicyclo[3.2.1]octan-4-yl]methyl-(2-sulfanylethyl)amino]ethylamino]ethanethiol structure
|
Common Name | 2-[2-[[3-(4-chlorophenyl)-8-methyl-8-azabicyclo[3.2.1]octan-4-yl]methyl-(2-sulfanylethyl)amino]ethylamino]ethanethiol | ||
|---|---|---|---|---|
| CAS Number | 189950-11-6 | Molecular Weight | 428.09800 | |
| Density | 1.143g/cm3 | Boiling Point | 534.622ºC at 760 mmHg | |
| Molecular Formula | C21H34ClN3S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 277.129ºC | |
| Name | 2-[2-[[3-(4-chlorophenyl)-8-methyl-8-azabicyclo[3.2.1]octan-4-yl]methyl-(2-sulfanylethyl)amino]ethylamino]ethanethiol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.143g/cm3 |
|---|---|
| Boiling Point | 534.622ºC at 760 mmHg |
| Molecular Formula | C21H34ClN3S2 |
| Molecular Weight | 428.09800 |
| Flash Point | 277.129ºC |
| Exact Mass | 427.18800 |
| PSA | 96.11000 |
| LogP | 3.98630 |
| InChIKey | HZLFSOZSLFKJKA-JSXRDJHFSA-N |
| SMILES | CN1C2CCC1C(CN(CCS)CCNCCS)C(c1ccc(Cl)cc1)C2 |
| Diagnosis or exclusion of Parkinsonian syndrome with or without dopaminergic deficit |