Urea, bis(phenylimino) structure
|
Common Name | Urea, bis(phenylimino) | ||
|---|---|---|---|---|
| CAS Number | 1900-38-5 | Molecular Weight | 238.24500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H10N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,3-bis(phenylimino)urea |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H10N4O |
|---|---|
| Molecular Weight | 238.24500 |
| Exact Mass | 238.08500 |
| PSA | 66.51000 |
| LogP | 4.67420 |
| InChIKey | GOTKJFIJTINXRP-UHFFFAOYSA-N |
| SMILES | O=C(N=Nc1ccccc1)N=Nc1ccccc1 |
| HS Code | 2927000090 |
|---|
|
~88%
Urea, bis(pheny... CAS#:1900-38-5 |
| Literature: Wang, Xiao-Yang; Wang, Yu-Lu; Zhang, Zi-Yi; Li, Jian-Ping; Wang, Cai-Lan Journal of the Chinese Chemical Society, 1998 , vol. 45, # 6 p. 835 - 837 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2927000090 |
|---|---|
| Summary | 2927000090 other diazo-, azo- or azoxy-compounds。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Diphenylcarbadiazone |
| 1,5-diphenyl-carbodiazone |
| Diphenyl-carbodiazon |
| Carbonil-bis-phenyldiimid |
| diphenylcarbodiazone |
| biphenyl carbodiazone |
| bisphenyl carbodiazone |
| 1,5-Diphenyl-carbodiazon |