Propanediamide, N1,N3-bis(4-nitrophenyl)- structure
|
Common Name | Propanediamide, N1,N3-bis(4-nitrophenyl)- | ||
|---|---|---|---|---|
| CAS Number | 1900-40-9 | Molecular Weight | 344.27900 | |
| Density | 1.539g/cm3 | Boiling Point | 714.5ºC at 760mmHg | |
| Molecular Formula | C15H12N4O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 385.9ºC | |
| Name | N,N'-bis(4-nitrophenyl)propanediamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.539g/cm3 |
|---|---|
| Boiling Point | 714.5ºC at 760mmHg |
| Molecular Formula | C15H12N4O6 |
| Molecular Weight | 344.27900 |
| Flash Point | 385.9ºC |
| Exact Mass | 344.07600 |
| PSA | 149.84000 |
| LogP | 3.66270 |
| Vapour Pressure | 2.92E-20mmHg at 25°C |
| Index of Refraction | 1.71 |
| InChIKey | WBLWPECXWHXTJN-UHFFFAOYSA-N |
| SMILES | O=C(CC(=O)Nc1ccc([N+](=O)[O-])cc1)Nc1ccc([N+](=O)[O-])cc1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N,N'-Bis-(4-nitro-phenyl)-malonamid |
| Malonsaeure-bis-<4-nitro-anilid> |
| N,N'-bis(p-nitrophenyl)malonamide |
| N,N'-Bis-(4-nitro-phenyl)-malonamide |
| Malonsaeure-di-(4-nitro-anilid) |