5-(3 4-(DIMETHOXY)PHENYL)-1 3- structure
|
Common Name | 5-(3 4-(DIMETHOXY)PHENYL)-1 3- | ||
|---|---|---|---|---|
| CAS Number | 190064-28-9 | Molecular Weight | 248.27400 | |
| Density | 1.173g/cm3 | Boiling Point | 411.6ºC at 760 mmHg | |
| Molecular Formula | C14H16O4 | Melting Point | 166-170ºC(lit.) | |
| MSDS | N/A | Flash Point | 184.1ºC | |
| Name | 5-(3,4-Dimethoxyphenyl)cyclohexane-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.173g/cm3 |
|---|---|
| Boiling Point | 411.6ºC at 760 mmHg |
| Melting Point | 166-170ºC(lit.) |
| Molecular Formula | C14H16O4 |
| Molecular Weight | 248.27400 |
| Flash Point | 184.1ºC |
| Exact Mass | 248.10500 |
| PSA | 52.60000 |
| LogP | 2.10950 |
| Vapour Pressure | 5.52E-07mmHg at 25°C |
| Index of Refraction | 1.533 |
| InChIKey | IRKIDJHFWYGNFG-UHFFFAOYSA-N |
| SMILES | COc1ccc(C2CC(=O)CC(=O)C2)cc1OC |
| HS Code | 2914509090 |
|---|
|
~91%
5-(3 4-(DIMETHO... CAS#:190064-28-9 |
| Literature: Mitsubishi-Tokyo Pharmaceuticals, Inc. Patent: US6069176 A1, 2000 ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| MFCD01954969 |